CAS 4056-73-9

2-acetyl-1,3-cyclohexanedione

Description:

2-Acetyl-1,3-cyclohexanedione, with the CAS number 4056-73-9, is an organic compound characterized by its diketone structure, featuring two carbonyl groups adjacent to a cyclohexane ring. This compound typically appears as a yellow to orange crystalline solid and is known for its ability to participate in various chemical reactions, including condensation and Michael addition reactions. It is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic cyclohexane ring. The presence of the acetyl group enhances its reactivity, making it useful in synthetic organic chemistry, particularly in the synthesis of more complex molecules. Additionally, 2-acetyl-1,3-cyclohexanedione exhibits interesting properties such as chelation with metal ions, which can be exploited in coordination chemistry. Its unique structure and reactivity profile make it a valuable compound in both academic research and industrial applications, particularly in the fields of pharmaceuticals and agrochemicals.

Formula: C₈H₁₀O₃

InChI: InChI=1/C8H10O3/c1-5(9)8-6(10)3-2-4-7(8)11/h8H,2-4H2,1H3

SMILES: CC(=O)C1C(=O)CCCC1=O

Synonyms:

• 2-Acetylcyclohexane-1,3-Dione

2-ACETYL-1,3-CYCLOHEXANEDIONE

CAS: 4056-73-9

Formula: C₈H₁₀O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 154.1632

Ref: IN-DA003GAR

2-Acetyl-1,3-cyclohexanedione

CAS: 4056-73-9

2-Acetyl-1,3-cyclohexanedione

Purity: 97%

Molecular weight: 154.16g/mol

Ref: 54-OR930355

2-Acetylcyclohexane-1,3-dione

CAS: 4056-73-9

Formula: C₈H₁₀O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 154.165

Ref: 10-F549729

2-Acetyl-cyclohexane-1,3-dione

CAS: 4056-73-9

2-Acetyl-cyclohexane-1,3-dione is a synthetic compound that belongs to the class of quinoline derivatives. It has been used as an antimicrobial agent in cosmetics and topical pharmaceuticals. 2-Acetyl-cyclohexane-1,3-dione has shown bacteriostatic properties against Staphylococcus and Clostridium perfringens, but not against Listeria monocytogenes. This antibiotic also functions as a preservative against Gram-positive bacteria, but not against Gram negative bacteria such as Escherichia coli. 2-Acetyl-cyclohexane-1,3-dione binds to metal ions such as copper and zinc by chelation. The structure of this compound contains a diphenyl ether group and a benzyl group.

Formula: C₈H₁₀O₃

Purity: Min. 95%

Molecular weight: 154.16 g/mol

Ref: 3D-EAA05673