CymitQuimica logo

CAS 40573-09-9

:

1,1,2,2,3,3-Hexafluoro-1-[(1,2,2-trifluoroethenyl)oxy]-3-(trifluoromethoxy)propane

Description:
1,1,2,2,3,3-Hexafluoro-1-[(1,2,2-trifluoroethenyl)oxy]-3-(trifluoromethoxy)propane, with CAS number 40573-09-9, is a fluorinated organic compound characterized by its complex structure featuring multiple fluorine atoms. This substance is part of a class of chemicals known for their high stability and low reactivity due to the presence of fluorine, which enhances their resistance to thermal and chemical degradation. It typically exhibits a low boiling point and high density, common traits among fluorinated compounds. The presence of multiple fluorinated groups contributes to its unique properties, such as low surface tension and high lipophobicity, making it useful in various applications, including as a solvent or in specialty coatings. Additionally, its molecular structure may impart specific characteristics such as low volatility and potential utility in the development of advanced materials. However, the environmental and health impacts of such fluorinated compounds are subjects of ongoing research, particularly concerning their persistence and potential bioaccumulation.
Formula:C6F12O2
InChI:InChI=1S/C6F12O2/c7-1(8)2(9)19-4(12,13)3(10,11)5(14,15)20-6(16,17)18
InChI key:InChIKey=ZWWNWGPNBZIACR-UHFFFAOYSA-N
SMILES:C(C(OC(=C(F)F)F)(F)F)(C(OC(F)(F)F)(F)F)(F)F
Found 4 products.