CAS 40581-18-8
:emerin
Description:
Emerin is a protein encoded by the EMD gene, primarily associated with the inner nuclear membrane in eukaryotic cells. It plays a crucial role in maintaining nuclear structure and function, as well as in the organization of the cytoskeleton. Emerin is particularly significant in muscle cells, where it is involved in the integrity of the nuclear envelope and is linked to certain muscular dystrophies when mutated. The CAS number 40581-18-8 refers to a specific chemical substance, which is often used in research contexts, particularly in studies related to cell biology and genetics. Emerin's characteristics include its role in cellular signaling, interaction with other nuclear envelope proteins, and involvement in the mechanical stability of the nucleus. Its dysfunction can lead to various pathologies, highlighting its importance in cellular health. Overall, emerin is a vital component of the nuclear architecture, influencing both structural and functional aspects of the cell nucleus.
Formula:C20H16N2O2
InChI:InChI=1/C20H16N2O2/c1-23-19-7-3-15(4-8-19)11-17(13-21)18(14-22)12-16-5-9-20(24-2)10-6-16/h3-12H,1-2H3/b17-11+,18-12+
Synonyms:- 2,3-Bis[(4-methoxyphenyl)methylene]butanedinitrile
- emerin
- Butanedinitrile, 2,3-bis[(4-methoxyphenyl)methylene]-, (2Z,3Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Emerin
CAS:<p>Emerin is an antibiotic found in the Aspergillus nidulans strain.</p>Formula:C20H16N2O2Color and Shape:SolidMolecular weight:316.353
