CAS 405878-90-2: Cyclopropanemethanamine, N-(3,3,3-trifluoropropyl)-, hydrochloride (1:1)

Description:Cyclopropanemethanamine, N-(3,3,3-trifluoropropyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique cyclopropane structure combined with an amine functional group. The presence of the trifluoropropyl substituent introduces significant electronegativity and steric effects, which can influence the compound's reactivity and solubility. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it easier to handle in various applications. The trifluoromethyl group is known for imparting lipophilicity and can enhance biological activity, making this compound of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Additionally, the cyclopropane ring can contribute to unique conformational properties, which may affect the compound's interaction with biological targets. Overall, this compound exemplifies the interplay between structural features and functional properties in organic chemistry.

Formula:C₇H₁₂F₃N·ClH

InChI:InChI=1S/C7H12F3N.ClH/c8-7(9,10)3-4-11-5-6-1-2-6;/h6,11H,1-5H2;1H

InChI key:InChIKey=FCWRXBKVRGHZHM-UHFFFAOYSA-N

SMILES:Cl.FC(F)(F)CCNCC1CC1