CAS 405879-03-0

Benzenemethanamine, 4-fluoro-N-(2,2,2-trifluoroethyl)-, hydrochloride (1:1)

Description:

Benzenemethanamine, 4-fluoro-N-(2,2,2-trifluoroethyl)-, hydrochloride (1:1), with the CAS number 405879-03-0, is a chemical compound characterized by its aromatic amine structure, which includes a benzene ring substituted with a fluorine atom and a trifluoroethyl group. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in pharmaceutical and chemical research. The presence of the trifluoroethyl group contributes to its lipophilicity, potentially influencing its biological activity and interaction with biological systems. The fluorine substituents can also impart unique electronic properties, affecting the compound's reactivity and stability. As with many amines, it may exhibit basic properties, allowing it to form salts with acids. Safety and handling precautions are essential due to the potential toxicity associated with fluorinated compounds. Overall, this compound's unique structural features make it of interest in medicinal chemistry and related fields.

Formula: C₉H₉F₄N·ClH

InChI: InChI=1S/C9H9F4N.ClH/c10-8-3-1-7(2-4-8)5-14-6-9(11,12)13;/h1-4,14H,5-6H2;1H

InChI key: InChIKey=NPOTUBGUHSNDBJ-UHFFFAOYSA-N

SMILES: C(NCC(F)(F)F)C1=CC=C(F)C=C1.Cl

Synonyms:

• [(4-Fluorophenyl)methyl](2,2,2-trifluoroethyl)amine hydrochloride
• Benzenemethanamine, 4-fluoro-N-(2,2,2-trifluoroethyl)-, hydrochloride
• Benzenemethanamine, 4-fluoro-N-(2,2,2-trifluoroethyl)-, hydrochloride (1:1)

[(4-Fluorophenyl)methyl](2,2,2-trifluoroethyl)amine hydrochloride

CAS: 405879-03-0

Versatile small molecule scaffold

Formula: C₉H₁₀ClF₄N

Purity: Min. 95%

Molecular weight: 243.63 g/mol

Ref: 3D-FRA87903