CAS 405930-65-6
:4-Benzyloxy-6-chloropyrimidine
Description:
4-Benzyloxy-6-chloropyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a benzyloxy group at the 4-position and a chlorine atom at the 6-position. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and dimethylformamide (DMF), but may have limited solubility in water. The presence of the benzyloxy group enhances its lipophilicity, which can influence its biological activity and interaction with various targets. The chlorine atom introduces a halogen, which can affect the compound's reactivity and stability. 4-Benzyloxy-6-chloropyrimidine is of interest in medicinal chemistry and drug development, particularly for its potential applications in the synthesis of pharmaceuticals and agrochemicals. Its unique structural features may contribute to specific biological activities, making it a subject of research in various fields, including medicinal chemistry and material science.
Formula:C11H9ClN2O
InChI:InChI=1/C11H9ClN2O/c12-10-6-11(14-8-13-10)15-7-9-4-2-1-3-5-9/h1-6,8H,7H2
SMILES:c1ccc(cc1)COc1cc(Cl)ncn1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Benzyloxy-6-chloropyrimidine, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C11H9ClN2OPurity:95%Color and Shape:Powder, White to pale creamMolecular weight:220.664-(Benzyloxy)-6-chloropyrimidine
CAS:4-(Benzyloxy)-6-chloropyrimidinePurity:≥95%Color and Shape:Low-Melting SolidMolecular weight:220.65g/mol4-(Benzyloxy)-6-chloropyrimidine
CAS:Versatile small molecule scaffoldFormula:C11H9ClN2OPurity:Min. 95%Molecular weight:220.65 g/mol



