CAS 405939-28-8

tert-butyl (4-iodopyridin-2-yl)carbamate

Description:

Tert-butyl (4-iodopyridin-2-yl)carbamate is an organic compound characterized by its carbamate functional group, which is linked to a tert-butyl group and a 4-iodopyridin-2-yl moiety. This compound typically appears as a solid or crystalline substance and is soluble in organic solvents such as dichloromethane and dimethyl sulfoxide, but may have limited solubility in water due to its hydrophobic tert-butyl group. The presence of the iodine atom in the pyridine ring enhances its reactivity, making it useful in various synthetic applications, including medicinal chemistry and the development of pharmaceuticals. The compound's structure allows for potential interactions with biological targets, which can be explored in drug design. Additionally, the tert-butyl group contributes to the steric bulk, influencing the compound's overall reactivity and stability. Safety data should be consulted for handling, as compounds containing iodine can pose health risks. Overall, tert-butyl (4-iodopyridin-2-yl)carbamate is a versatile compound with applications in organic synthesis and medicinal chemistry.

Formula: C₁₀H₁₃IN₂O₂

InChI: InChI=1/C10H13IN2O2/c1-10(2,3)15-9(14)13-8-6-7(11)4-5-12-8/h4-6H,1-3H3,(H,12,13,14)

SMILES: CC(C)(C)OC(=Nc1cc(ccn1)I)O

Synonyms:

• 2-Boc-amino-4-iodopyridine

tert-butyl N-(4-iodopyridin-2-yl)carbamate

CAS: 405939-28-8

Formula: C₁₀H₁₃IN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 320.1269

Ref: IN-DA00BYJ3