CAS 405939-39-1

tert-butyl N-(5-bromothiazol-2-yl)carbamate

Description:

Tert-butyl N-(5-bromothiazol-2-yl)carbamate is a chemical compound characterized by its unique structure, which includes a tert-butyl group, a carbamate functional group, and a thiazole ring substituted with a bromine atom. This compound typically exhibits properties associated with both the carbamate and thiazole moieties, such as potential biological activity and solubility in organic solvents. The presence of the bromine atom may enhance its reactivity and influence its interactions in biological systems. Tert-butyl N-(5-bromothiazol-2-yl)carbamate is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to the thiazole's role in various biological activities. Additionally, the tert-butyl group contributes to the compound's stability and lipophilicity, which can affect its pharmacokinetic properties. As with many chemical substances, safety and handling precautions should be observed, given the potential hazards associated with brominated compounds and carbamates.

Formula: C₈H₁₁BrN₂O₂S

InChI: InChI=1/C8H11BrN2O2S/c1-8(2,3)13-7(12)11-6-10-4-5(9)14-6/h4H,1-3H3,(H,10,11,12)

SMILES: CC(C)(C)OC(=Nc1ncc(Br)s1)O

Synonyms:

• tert-Butyl (5-bromo-1,3-thiazol-2-yl)carbamate
• tert-Butyl (5-bromothiazol-2-yl)carbamate

N-Boc-2-amino-5-bromothiazole

CAS: 405939-39-1

Formula: C₈H₁₁BrN₂O₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 279.1541

Ref: IN-DA00C5N2

tert-Butyl N-(5-bromo-1,3-thiazol-2-yl)carbamate

CAS: 405939-39-1

tert-Butyl N-(5-bromo-1,3-thiazol-2-yl)carbamate

Purity: 97%

Color and Shape: Solid

Molecular weight: 279.15g/mol

Ref: 54-OR310323

N-Boc-2-Amino-5-bromothiazole

CAS: 405939-39-1

Formula: C₈H₁₁BrN₂O₂S

Purity: 97%

Color and Shape: Solid, White powder

Molecular weight: 279.15

Ref: 10-F078265