CAS 406-00-8
:4-fluoro-N-hydroxyaniline
Description:
4-Fluoro-N-hydroxyaniline, with the CAS number 406-00-8, is an organic compound characterized by the presence of a fluorine atom and a hydroxylamine functional group attached to an aniline structure. This compound typically appears as a solid and is known for its pale yellow to light brown color. It is soluble in polar solvents, such as water and alcohols, due to the presence of the hydroxyl group, which can engage in hydrogen bonding. The fluorine substituent can influence the compound's reactivity and stability, making it useful in various chemical applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, 4-fluoro-N-hydroxyaniline may exhibit biological activity, which can be of interest in medicinal chemistry. However, handling this compound requires caution due to potential toxicity and environmental considerations. Proper safety measures should be taken when working with this substance in laboratory settings.
Formula:C6H6FNO
InChI:InChI=1/C6H6FNO/c7-5-1-3-6(8-9)4-2-5/h1-4,8-9H
SMILES:c1cc(ccc1F)NO
Synonyms:- benzenamine, 4-fluoro-N-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(p-Fluorophenyl)-hydroxylamine
CAS:Controlled ProductApplications N-(p-Fluorophenyl)-hydroxylamine, is a reactant used in various chemical synthesis, such as in preparation of spiro-isoxazoline and spiro-isoxazolidine derivatives of tomentosin.
References Zaki, M., et al.: RSC Advances, Vol. 7, Iss 11, P: 6523-6529 (2017);Formula:C6H6FNOColor and Shape:NeatMolecular weight:127.116
