CAS 40615-04-1

3-Aminomethyl benzo[b]thiophene

Description:

3-Aminomethyl benzo[b]thiophene is an organic compound characterized by the presence of both an amino group and a thiophene ring fused to a benzene structure. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including stability and potential reactivity due to the amino group. The amino group can participate in hydrogen bonding and may influence the compound's solubility in various solvents. Additionally, the thiophene moiety contributes to the compound's electronic properties, which can be significant in applications such as organic electronics or pharmaceuticals. The presence of the benzo[b]thiophene structure suggests potential biological activity, making it of interest in medicinal chemistry. Its CAS number, 40615-04-1, allows for easy identification in chemical databases. Overall, 3-Aminomethyl benzo[b]thiophene is a compound of interest due to its unique structural features and potential applications in various fields of chemistry and material science.

Formula: C₉H₉NS

InChI: InChI=1/C9H9NS/c10-5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6H,5,10H2

SMILES: c1ccc2c(c1)c(CN)cs2

Synonyms:

• 1-Benzothiophene-3-Ylmethylamine
• Benzothiophene-3-Methylamine
• Benzo[B]Thiophen-3-Ylmethylamine
• Benzothiophen-3-Ylmethanamine

1-Benzothiophen-3-ylmethanamine

CAS: 40615-04-1

Formula: C₉H₉NS

Purity: 95%

Color and Shape: Liquid

Molecular weight: 163.2395

Ref: IN-DA003I69

3-(Aminomethyl)benzo[b]thiophene

CAS: 40615-04-1

3-(Aminomethyl)benzo[b]thiophene

Purity: 95%

Molecular weight: 163.24g/mol

Ref: 54-OR76624

Benzo[b]thiophen-3-ylmethanamine

CAS: 40615-04-1

Formula: C₉H₉NS

Purity: 95%

Color and Shape: Liquid, No data available.

Molecular weight: 163.24

Ref: 10-F338512