CAS 406212-49-5

1,1-Dimethylethyl 3-formyl-3-methyl-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 3-formyl-3-methyl-1-piperidinecarboxylate, identified by its CAS number 406212-49-5, is an organic compound characterized by its piperidine structure, which includes a carboxylate functional group and an aldehyde group. This compound features a tert-butyl group (1,1-dimethylethyl) that contributes to its steric bulk, influencing its reactivity and solubility. The presence of the formyl group indicates that it can participate in various chemical reactions, such as condensation and nucleophilic addition. The methyl substituent on the piperidine ring can affect the compound's overall polarity and interaction with other molecules. Typically, compounds of this nature may exhibit moderate to high lipophilicity, making them potentially useful in medicinal chemistry and as intermediates in organic synthesis. Additionally, the structural features suggest potential applications in the development of pharmaceuticals or agrochemicals, although specific biological activities would require further investigation. Overall, this compound exemplifies the complexity and versatility of nitrogen-containing heterocycles in organic chemistry.

Formula: C₁₂H₂₁NO₃

InChI: InChI=1S/C12H21NO3/c1-11(2,3)16-10(15)13-7-5-6-12(4,8-13)9-14/h9H,5-8H2,1-4H3

InChI key: InChIKey=GFIQXPZTOFYEMI-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC(C=O)(C)CCC1

Synonyms:

• tert-Butyl 3-formyl-3-methylpiperidine-1-carboxylate
• 1,1-Dimethylethyl 3-formyl-3-methyl-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 3-formyl-3-methyl-, 1,1-dimethylethyl ester

tert-Butyl 3-formyl-3-methylpiperidine-1-carboxylate

CAS: 406212-49-5

Versatile small molecule scaffold

Formula: C₁₂H₂₁NO₃

Purity: Min. 95%

Molecular weight: 227.3 g/mol

Ref: 3D-GRA21249