CAS 406235-30-1

tert-butyl 4-hydroxy-4-methylpiperidine-1-carboxylate

Description:

Tert-butyl 4-hydroxy-4-methylpiperidine-1-carboxylate is a chemical compound characterized by its piperidine structure, which includes a tert-butyl ester group and a hydroxyl functional group. This compound typically appears as a white to off-white solid and is soluble in organic solvents, reflecting its moderate polarity due to the presence of both hydrophobic (tert-butyl) and hydrophilic (hydroxyl) groups. The piperidine ring contributes to its basicity and potential reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its molecular structure allows for various chemical modifications, enhancing its versatility in synthetic applications. Additionally, the compound may exhibit specific biological activities, which can be explored in medicinal chemistry contexts. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₁H₂₁NO₃

InChI: InChI=1/C11H21NO3/c1-10(2,3)15-9(13)12-7-5-11(4,14)6-8-12/h14H,5-8H2,1-4H3

SMILES: CC(C)(C)OC(=O)N1CCC(C)(CC1)O

Synonyms:

• N-Boc-4-methyl-4-hydroxy piperidine
• 1-Boc-4-methyl-piperidin-4-ol

N-Boc-4-Hydroxy-4-methylpiperidine

CAS: 406235-30-1

Formula: C₁₁H₂₁NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 215.2893

Ref: IN-DA0076DE

tert-Butyl 4-hydroxy-4-methylpiperidine-1-carboxylate

CAS: 406235-30-1

tert-Butyl 4-hydroxy-4-methylpiperidine-1-carboxylate

Purity: 99%

Molecular weight: 215.29g/mol

Ref: 54-OR72981

1-Boc-4-methyl-piperidin-4-ol

CAS: 406235-30-1

Formula: C₁₁H₂₁NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 215.293

Ref: 10-F040645