CAS 40637-56-7: Propanedioic acid, 2-(2-propen-1-yl)-, 1,3-dimethyl ester
Description:Propanedioic acid, 2-(2-propen-1-yl)-, 1,3-dimethyl ester, commonly known as dimethyl 2-(2-propen-1-yl)malonate, is an organic compound characterized by its ester functional groups and a propenyl substituent. It features a propanedioic acid backbone with two methyl ester groups at the 1 and 3 positions, and a vinyl group at the 2 position, which contributes to its reactivity and potential applications in organic synthesis. This compound is typically a colorless to pale yellow liquid with a fruity odor, and it is soluble in organic solvents. Its structure allows for participation in various chemical reactions, including Michael additions and polymerization processes, making it valuable in the synthesis of more complex molecules. Additionally, it may exhibit biological activity, although specific biological properties would require further investigation. Safety data indicates that, like many esters, it should be handled with care to avoid inhalation or skin contact. Overall, its unique structure and reactivity profile make it an interesting compound in both academic and industrial chemistry contexts.
Formula:C8H12O4
InChI:InChI=1S/C8H12O4/c1-4-5-6(7(9)11-2)8(10)12-3/h4,6H,1,5H2,2-3H3
InChI key:InChIKey=VZNFVLWVVHHMBG-UHFFFAOYSA-N
SMILES:O=C(OC)C(C(=O)OC)CC=C
- Synonyms:
- 1,3-Dimethyl 2-(prop-2-en-1-yl)propanedioate
- 4,4-Bis(carboxymethoxy)-1-butene
- Allylmalonic acid dimethyl ester
- Dimethyl 2-(2-propenyl)malonate
- Dimethyl 2-(prop-2-enyl)propane-1,3-dioate
- Dimethyl 2-allylmalonate
- Dimethyl Prop-2-En-1-Ylpropanedioate
- Propanedioic acid, 2-(2-propen-1-yl)-, 1,3-dimethyl ester
- Propanedioic acid, 2-propenyl-, dimethyl ester
- Dimethyl allylmalonate
- See more synonyms
