CAS 40643-55-8
:N-methyl-N-phenylglycine
Description:
N-methyl-N-phenylglycine, with the CAS number 40643-55-8, is an organic compound characterized by its structure, which includes a glycine backbone with a methyl group and a phenyl group attached to the nitrogen atom. This compound typically appears as a white to off-white solid and is soluble in polar solvents, reflecting its polar functional groups. It exhibits properties typical of amino acids, such as the ability to participate in hydrogen bonding due to the presence of both an amine and a carboxylic acid functional group. N-methyl-N-phenylglycine is of interest in various fields, including pharmaceuticals and biochemistry, due to its potential role as a building block in the synthesis of more complex molecules. Additionally, it may exhibit biological activity, making it a subject of research in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H11NO2
InChI:InChI=1/C9H11NO2/c1-10(7-9(11)12)8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H,11,12)
SMILES:CN(CC(=O)O)c1ccccc1
Synonyms:- glycine, N-methyl-N-phenyl-
- N-Methyl-N-phenylglycine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
N-methyl-N-phenylglycine
CAS:Formula:C9H11NO2Purity:97%Color and Shape:LiquidMolecular weight:165.1891N-Methyl-N-phenylglycine hydrochloride
CAS:N-Methyl-N-phenylglycine hydrochloride (NMPG) is a glycopeptide antibiotic and immunosuppressant that is used to treat inflammatory bowel disease. NMPG binds to the D-alanyl-D-alanine moiety of bacterial cell wall peptidoglycan, inhibiting the synthesis of bacterial cell wall and leading to bacterial death. NMPG has been shown to be active against Escherichia coli, Klebsiella pneumoniae, and Helicobacter pylori. NMPG also has antibacterial activity against Acinetobacter baumannii and Enterococcus faecalis. The asymmetric synthesis of NMPG is enhanced by the presence of acrylonitrile.Formula:C9H11NO2·HClPurity:Min. 95%Color and Shape:PowderMolecular weight:201.65 g/mol


