CymitQuimica logo

CAS 40644-16-4

:

4-Bromo-1,3-dihydro-2H-benzimidazol-2-one

Description:
4-Bromo-1,3-dihydro-2H-benzimidazol-2-one is a chemical compound characterized by its unique structure, which includes a benzimidazole core with a bromine substituent. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in polar solvents and potential reactivity due to the presence of the bromine atom. The presence of the carbonyl group in the 2-position contributes to its stability and may influence its reactivity in various chemical reactions, including nucleophilic substitutions. Additionally, the compound may display biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for various functionalization possibilities, which can be explored for synthesizing derivatives with enhanced properties. As with many brominated compounds, it may also exhibit specific environmental and safety considerations, necessitating careful handling and disposal. Overall, 4-Bromo-1,3-dihydro-2H-benzimidazol-2-one represents a versatile scaffold for further chemical exploration and application.
Formula:C7H5BrN2O
InChI:InChI=1S/C7H5BrN2O/c8-4-2-1-3-5-6(4)10-7(11)9-5/h1-3H,(H2,9,10,11)
InChI key:InChIKey=MRCJIYLGWGVZJQ-UHFFFAOYSA-N
SMILES:BrC1=C2C(NC(=O)N2)=CC=C1
Synonyms:
  • 4-Bromo-1,3-dihydro-2H-benzimidazol-2-one
  • 4-Bromobenzimidazol-2(3H)-one
  • 2H-Benzimidazol-2-one, 4-bromo-1,3-dihydro-
  • 4-Bromo-1,3-dihydro-2H-benzo[d]imidazol-2-one
  • 4-bromo-1H-benzo[d]imidazol-2(3H)-one
  • 4-Bromo-1,3-dihydro-benzoimidazol-2-one
  • 4-bromo-1,3-dihydrobenzimidazol-2-one
Found 5 products.