CAS 406470-68-6

Methyl 5-[(4-chlorophenoxy)methyl]-2-furancarboxylate

Description:

Methyl 5-[(4-chlorophenoxy)methyl]-2-furancarboxylate, with the CAS number 406470-68-6, is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a methyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of the 4-chlorophenoxy group indicates that it has a chlorinated aromatic moiety, which can influence its biological activity and chemical properties. Typically, compounds of this nature may exhibit moderate to high lipophilicity due to the aromatic components, affecting their interaction with biological systems. The furan ring can also participate in various chemical reactions, such as electrophilic substitution or nucleophilic attack, making it a versatile building block in organic synthesis. Additionally, the compound may possess potential applications in pharmaceuticals or agrochemicals, although specific biological activities would depend on further empirical studies. Overall, its unique structural features suggest a range of possible chemical behaviors and applications in various fields.

Formula: C₁₃H₁₁ClO₄

InChI: InChI=1S/C13H11ClO4/c1-16-13(15)12-7-6-11(18-12)8-17-10-4-2-9(14)3-5-10/h2-7H,8H2,1H3

InChI key: InChIKey=LANUDODLVMMCPH-UHFFFAOYSA-N

SMILES: C(OC1=CC=C(Cl)C=C1)C=2OC(C(OC)=O)=CC2

Synonyms:

• Methyl 5-[(4-chlorophenoxy)methyl]-2-furancarboxylate
• 2-Furancarboxylic acid, 5-[(4-chlorophenoxy)methyl]-, methyl ester

Methyl 5-[(4-chlorophenoxy)methyl]-2-furoate

CAS: 406470-68-6

Versatile small molecule scaffold

Formula: C₁₃H₁₁ClO₄

Purity: Min. 95%

Molecular weight: 266.67 g/mol

Ref: 3D-GRA47068