CymitQuimica logo

CAS 406482-19-7

:

2-Fluoro-5-methoxyphenylboronic acid

Description:
2-Fluoro-5-methoxyphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that also contains a fluorine atom and a methoxy group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and alcohols, which is a common trait of boronic acids due to their ability to form hydrogen bonds. The presence of the fluorine atom can influence the electronic properties of the molecule, potentially enhancing its reactivity in various chemical reactions, including Suzuki coupling reactions, which are widely used in organic synthesis. The methoxy group can also serve as a directing group in electrophilic aromatic substitution reactions. Additionally, boronic acids like this one are known for their ability to form reversible complexes with diols, making them useful in applications such as drug delivery and sensor technology. Overall, 2-Fluoro-5-methoxyphenylboronic acid is a versatile compound with significant utility in synthetic organic chemistry and materials science.
Formula:C7H8BFO3
InChI:InChI=1S/C7H8BFO3/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4,10-11H,1H3
InChI key:InChIKey=IPTZOWYBCLEBOE-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC(OC)=CC=C1F
Synonyms:
  • 2-Fluoro-5-methoxyphenylboronic acid
  • B-(2-Fluoro-5-methoxyphenyl)boronic acid
  • Boronic acid, (2-fluoro-5-methoxyphenyl)-
  • boronic acid, B-(2-fluoro-5-methoxyphenyl)-
  • (2-Fluoro-5-methoxyphenyl)boronic acid
  • 2-Fluoro-5-methoxyphenyl boronic acid
Found 6 products.