CAS 406482-22-2

4-Bromo-2,3-Difluoroanisole

Description:

4-Bromo-2,3-difluoroanisole is an organic compound characterized by the presence of a bromine atom and two fluorine atoms substituted on a methoxybenzene (anisole) structure. Its molecular formula typically includes carbon, hydrogen, bromine, and fluorine atoms, reflecting its halogenated nature. The compound is likely to exhibit moderate polarity due to the electronegative halogen substituents, which can influence its solubility in various solvents. The presence of the methoxy group contributes to its potential as a nucleophile in chemical reactions. Additionally, the bromine and fluorine atoms can impart unique reactivity and stability characteristics, making it of interest in synthetic organic chemistry and materials science. The compound may also exhibit specific spectral properties, such as distinct peaks in NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, 4-Bromo-2,3-difluoroanisole is a valuable compound in research and industrial applications, particularly in the development of pharmaceuticals and agrochemicals.

Formula: C₇H₅BrF₂O

InChI: InChI=1/C7H5BrF2O/c1-11-5-3-2-4(8)6(9)7(5)10/h2-3H,1H3

SMILES: COc1ccc(c(c1F)F)Br

Synonyms:

• 1-Bromo-2,3-difluoro-4-methoxybenzene
• 4-Bromo-2,3-difluorophenyl methyl ether
• Benzene, 1-Bromo-2,3-Difluoro-4-Methoxy-
• 2,3-Difluoro-4-bromoanisole
• 1-Bromo-4-Methoxy-2,3-Difluorobenzene

1-Bromo-2,3-difluoro-4-methoxybenzene

CAS: 406482-22-2

Formula: C₇H₅BrF₂O

Purity: %

Color and Shape: Solid

Molecular weight: 223.0148

Ref: IN-DA003E4Y

4-Bromo-2,3-difluoroanisole

CAS: 406482-22-2

4-Bromo-2,3-difluoroanisole

Purity: 99%

Color and Shape: Liquid

Molecular weight: 223.01g/mol

Ref: 54-PC7278

1-Bromo-2,3-difluoro-4-methoxybenzene

CAS: 406482-22-2

Formula: C₇H₅BrF₂O

Purity: 99+%

Color and Shape: Liquid

Molecular weight: 223.017

Ref: 10-F236896