CAS 40656-71-1

6-chloro-1-pentofuranosyl-1H-imidazo[4,5-c]pyridin-4-amine

Description:

6-Chloro-1-pentofuranosyl-1H-imidazo[4,5-c]pyridin-4-amine is a chemical compound characterized by its complex structure, which includes a furanosyl sugar moiety and an imidazo-pyridine core. The presence of a chlorine atom at the 6-position of the imidazo ring contributes to its unique reactivity and potential biological activity. This compound is likely to exhibit properties typical of nucleoside analogs, which may include antiviral or anticancer activities, as many compounds in this class are designed to interfere with nucleic acid synthesis. The imidazo[4,5-c]pyridine framework is known for its ability to interact with various biological targets, including enzymes and receptors. Additionally, the presence of the pentofuranosyl group suggests that it may mimic natural nucleosides, potentially allowing it to be incorporated into nucleic acids. Overall, the characteristics of this compound make it of interest in medicinal chemistry and pharmaceutical research, particularly in the development of new therapeutic agents.

Formula: C₁₁H₁₃ClN₄O₄

InChI: InChI=1/C11H13ClN4O4/c12-6-1-4-7(10(13)15-6)14-3-16(4)11-9(19)8(18)5(2-17)20-11/h1,3,5,8-9,11,17-19H,2H2,(H2,13,15)

SMILES: c1c2c(c(N)nc1Cl)ncn2C1C(C(C(CO)O1)O)O

Synonyms:

• 1H-imidazo[4,5-c]pyridin-4-amine, 6-chloro-1-pentofuranosyl-

2-Chloro-3-deazaadenosine

CAS: 40656-71-1

Ref: 7W-GN8616

4-Amino-6-chloro-1-β-D-ribofuranosylimidazo[4,5-c]pyridine

Controlled Product

CAS: 40656-71-1

Applications Adenosine analog
References Barbieri, D., et al.: Bioorg. Med. Chem. Lett., 8, 2533 (1998),

Formula: C₁₁H₁₃ClN₄O₄

Color and Shape: Neat

Molecular weight: 300.70

Ref: TR-A603514

2-Chloro-3-deazaadenosine

CAS: 40656-71-1

2-Chloro-3-deazaadenosine is an antiviral drug that inhibits the synthesis of DNA by acting as a competitive inhibitor for adenosine. It has been shown to be effective in the treatment of hepatitis B virus and herpes simplex virus infections. 2-Chloro-3-deazaadenosine prevents the incorporation of the natural nucleoside adenosine into DNA, which leads to inhibition of viral replication and cell division. This drug also has been shown to inactivate liver cells in bovines, which may account for its toxicity. The synthesis of 2-chloroadenosine is difficult and laborious due to its glycosylation, making it more expensive than other analogues that are more easily synthesized.

Formula: C₁₁H₁₃ClN₄O₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 300.7 g/mol

Ref: 3D-NC09808

4-Amino-6-chloro-1-β-D-ribofuranosylimidazo[4,5-c]pyridine

CAS: 40656-71-1

Formula: C₁₁H₁₃ClN₄O₄

Molecular weight: 300.7

Ref: ST-EA-CP-A88114