CAS 40661-45-8

Cornoside

Description:

Cornoside, with the CAS number 40661-45-8, is a chemical compound that belongs to the class of natural products known as flavonoids. It is primarily derived from various plant sources, particularly those in the genus Cornus, such as dogwood. Cornoside is characterized by its glycosidic structure, which typically consists of a flavonoid aglycone linked to a sugar moiety. This compound exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential neuroprotective effects, making it of interest in pharmacological research. Its solubility properties can vary depending on the solvent used, and it may exhibit UV-visible absorption characteristics typical of flavonoids. Cornoside's potential applications in health and medicine are being explored, particularly in the context of traditional herbal remedies. However, further studies are necessary to fully elucidate its mechanisms of action and therapeutic potential. As with many natural compounds, the specific characteristics and effects can be influenced by factors such as extraction methods and the presence of other phytochemicals.

Formula: C₁₄H₂₀O₈

InChI: InChI=1S/C14H20O8/c15-7-9-10(17)11(18)12(19)13(22-9)21-6-5-14(20)3-1-8(16)2-4-14/h1-4,9-13,15,17-20H,5-7H2/t9-,10-,11+,12-,13-/m1/s1

InChI key: InChIKey=VTVARPTUBCBNJX-UJPOAAIJSA-N

SMILES: O(CCC1(O)C=CC(=O)C=C1)[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O

Synonyms:

• 2,5-Cyclohexadien-1-one, 4-[2-(β-D-glucopyranosyloxy)ethyl]-4-hydroxy-
• 4-[2-(β-D-Glucopyranosyloxy)ethyl]-4-hydroxy-2,5-cyclohexadien-1-one
• Cornoside

4-[2-(β-D-Glucopyranosyloxy)ethyl]-4-hydroxy-2,5-cyclohexadien-1-one

CAS: 40661-45-8

Formula: C₁₄H₂₀O₈

Purity: 96.5%

Molecular weight: 316.3038

Ref: IN-DA00CT2I

Cornoside

CAS: 40661-45-8

Cornoside

Purity: ≥95%

Molecular weight: 316.3g/mol

Ref: 54-BUP20769

Cornoside

CAS: 40661-45-8

Cornoside is a natural phenolic glycoside that inhibits aldose reductase (AR) activity, reducing oxidative stress and inflammation in diabetic complications.

Formula: C₁₄H₂₀O₈

Purity: 97.19%

Color and Shape: Solid

Molecular weight: 316.3

Ref: TM-TN3703

Cornoside

CAS: 40661-45-8

Formula: C₁₄H₂₀O₈

Purity: 95%~99%

Molecular weight: 316.306

Ref: BP-BP4921

Cornoside

CAS: 40661-45-8

Cornoside is an iridoid glycoside, which is a naturally occurring compound sourced primarily from plants of the genus Cornus, commonly known as dogwoods. This compound is characterized by its diverse biological activities, which include notable antioxidant properties. The mode of action of Cornoside involves scavenging free radicals and inhibiting oxidative stress pathways, thereby protecting cellular components from oxidative damage.

Formula: C₁₄H₂₀O₈

Purity: Min. 95%

Molecular weight: 316.3 g/mol

Ref: 3D-QBA66145