CAS 40673-25-4
:4-Chloro-2-pyridinol
Description:
4-Chloro-2-pyridinol is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 4-position and a hydroxyl group (-OH) at the 2-position contributes to its unique chemical properties. This compound is typically a white to light yellow solid and is soluble in polar solvents such as water and alcohols, owing to the hydroxyl group. It exhibits moderate toxicity and can act as a weak acid due to the presence of the hydroxyl group. 4-Chloro-2-pyridinol is often used in the synthesis of various pharmaceuticals and agrochemicals, as well as in research applications. Its reactivity can be attributed to the electron-withdrawing nature of the chlorine substituent, which influences its behavior in chemical reactions. Additionally, it may serve as an intermediate in the production of other chemical compounds, highlighting its significance in organic synthesis. Proper handling and safety precautions are essential due to its potential health hazards.
Formula:C5H4ClNO
InChI:InChI=1/C5H4ClNO/c6-4-1-2-7-5(8)3-4/h1-3H,(H,7,8)
SMILES:c1cnc(cc1Cl)O
Synonyms:- 2-Hydroxy-4-Chloropyridine
- 4-chloropyridin-2(1H)-one
- 4-Chloro-2-hydroxypyridine
- 4-Chloropyridin-2-ol
- 4-Chloro-Pyridin-2-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2(1H)-Pyridinone,4-chloro-
CAS:Formula:C5H4ClNOPurity:96%Color and Shape:SolidMolecular weight:129.54444-Chloro-2-hydroxypyridine
CAS:Formula:C5H4ClNOPurity:96%Color and Shape:SolidMolecular weight:129.544-Chloro-2-hydroxypyridine
CAS:Formula:C5H4ClNOPurity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:129.544-Chloro-2-hydroxypyridine
CAS:4-Chloro-2-hydroxypyridine is a chemical substance that has been shown to inhibit the replication of viruses in cell culture. It has demonstrated antiobesity effects in animal studies, but its mechanism is not well understood. This substance may be a thioxanthone derivative, which are heterocyclic compounds containing oxygen and sulfur. 4-Chloro-2-hydroxypyridine can crosslink DNA and form adducts with deoxyribose sugars. It also has affinity for sequences containing pyridones and imidazopyridines.
Formula:C5H4ClNOPurity:Min. 95%Molecular weight:129.54 g/mol




