CAS 40675-81-8
:1-(naphthalen-1-ylmethyl)piperazinediium
Description:
1-(Naphthalen-1-ylmethyl)piperazinediium, with the CAS number 40675-81-8, is a chemical compound characterized by its unique structure, which includes a naphthalene moiety attached to a piperazine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential biological activity. The presence of the naphthalene group may contribute to its hydrophobic characteristics, while the piperazine ring can impart basicity and the ability to form salts. This compound is often studied in the context of medicinal chemistry due to its potential interactions with biological targets, including receptors and enzymes. Its di-cationic nature suggests that it may have enhanced solubility in polar solvents and could participate in various ionic interactions. Overall, 1-(naphthalen-1-ylmethyl)piperazinediium is of interest for its structural features and potential applications in pharmaceuticals and materials science.
Formula:C15H20N2
InChI:InChI=1/C15H18N2/c1-2-7-15-13(4-1)5-3-6-14(15)12-17-10-8-16-9-11-17/h1-7,16H,8-12H2/p+2
Synonyms:- 1-(1-naphthylmethyl)piperazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-(1-Naphthylmethyl)piperazine, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C15H18N2Purity:97%Molecular weight:226.321-(1-Naphthylmethyl)piperazine
CAS:Formula:C15H18N2Purity:98%Color and Shape:SolidMolecular weight:226.31681-(Naphth-1-ylmethyl)piperazine
CAS:1-(Naphth-1-ylmethyl)piperazineFormula:C15H18N2Purity:97%Color and Shape: light yellow powderMolecular weight:226.32g/mol1-(1-Naphthylmethyl)piperazine
CAS:Purity:98.0%Color and Shape:SolidMolecular weight:226.3229980468751-(1-Naphthylmethyl)piperazine
CAS:1-(1-Naphthylmethyl)piperazine (1-NMPP) is an antimicrobial agent that inhibits bacterial efflux pumps. It was shown to be active against Gram-positive bacteria, such as Erythromycin and tetracycline resistant mutants. 1-NMPP has been shown to inhibit the expression of efflux pump proteins in Gram-negative bacteria. One study showed that 1-NMPP can reverse the resistance of colistin and sulfa drugs in a multidrug resistant strain of Staphylococcus aureus. The mechanism of action for this drug is not yet known, but it may be due to its ability to prevent the synthesis of new efflux pump proteins by inhibiting translation or by decreasing mRNA stability.Formula:C15H18N2Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:226.32 g/mol




