CAS 4068-62-6

3-chloro-5-fluoro-2-hydroxy-benzoic acid

Description:

3-Chloro-5-fluoro-2-hydroxy-benzoic acid, with the CAS number 4068-62-6, is an aromatic carboxylic acid characterized by the presence of a hydroxyl group, a chlorine atom, and a fluorine atom on a benzene ring. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydroxyl group. The chlorine and fluorine substituents contribute to its unique reactivity and potential applications in pharmaceuticals and agrochemicals. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its structural features suggest potential for interactions with biological targets, which could be explored for therapeutic applications. As with many halogenated compounds, safety and handling precautions are essential due to potential toxicity and environmental impact.

Formula: C₇H₄ClFO₃

InChI: InChI=1/C7H4ClFO3/c8-5-2-3(9)1-4(6(5)10)7(11)12/h1-2,10H,(H,11,12)

SMILES: c1c(cc(c(c1C(=O)O)O)Cl)F

Synonyms:

• 3-Chloro-5-Fluoro-2-Hydroxybenzoic Acid
• Benzoic Acid, 3-Chloro-5-Fluoro-2-Hydroxy-

3-Chloro-5-fluorosalicylic acid

CAS: 4068-62-6

Formula: C₇H₄ClFO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 190.5563

Ref: IN-DA00C77I

3-Chloro-5-fluoro-2-hydroxybenzoic acid

CAS: 4068-62-6

3-Chloro-5-fluoro-2-hydroxybenzoic acid

Formula: C₇H₄ClFO₃

Purity: ≥95%

Color and Shape: off-white powder

Molecular weight: 190.56g/mol

Ref: 54-PC57540

3-chloro-5-fluoro-2-hydroxybenzoic Acid

Controlled Product

CAS: 4068-62-6

Applications 3-chloro-5-fluoro-2-hydroxybenzoic acid (cas# 4068-62-6) is a useful research chemical.

Formula: C₇H₄O₃FCl

Color and Shape: Neat

Molecular weight: 190.56

Ref: TR-C375058