CAS 4068-76-2
:5-Bromo-2-hydroxybenzoic acid methyl ester
Description:
5-Bromo-2-hydroxybenzoic acid methyl ester, with the CAS number 4068-76-2, is an organic compound that belongs to the class of benzoic acid derivatives. It features a bromine atom and a hydroxyl group attached to a benzene ring, along with a methyl ester functional group. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as methanol and ethanol, but has limited solubility in water. Its molecular structure contributes to its potential applications in pharmaceuticals and agrochemicals, particularly as an intermediate in the synthesis of various bioactive compounds. The presence of the bromine atom may impart unique reactivity, making it useful in substitution reactions. Additionally, the hydroxyl group can participate in hydrogen bonding, influencing its physical properties and reactivity. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C8H7BrO3
InChI:InChI=1S/C8H7BrO3/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4,10H,1H3
InChI key:InChIKey=FJYDBKPPGRZSOZ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(O)C=CC(Br)=C1
Synonyms:- 2-Hydroxy-5-bromobenzoic acid methyl ester
- 4-Bromo-2-(methoxycarbonyl)phenol
- 5-Bromo-2-hydroxybenzoic acid methyl ester
- Ai3-04028
- Benzoic acid, 5-bromo-2-hydroxy-, methyl ester
- Methyl 2-hydroxy-5-bromobenzoate
- Methyl 5-Bromo-2-Hydroxybenzoate
- NSC 30264
- Salicylic acid, 5-bromo-, methyl ester
- Methyl 5-bromosalicylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 5-bromo-2-hydroxybenzoate
CAS:Formula:C8H7BrO3Purity:98%Color and Shape:SolidMolecular weight:231.0434Methyl 5-bromo-2-hydroxybenzoate
CAS:Methyl 5-bromo-2-hydroxybenzoateFormula:C8H7BrO3Purity:≥95%Color and Shape: white crystalline powderMolecular weight:231.04g/mol5-Bromosalicylic acid methyl ester
CAS:5-Bromosalicylic acid methyl ester is a hydroxylated bromo derivative of salicylic acid. It is a synthetic chemical that has been shown to be stable in various conditions and reactive with other compounds. 5-Bromosalicylic acid methyl ester has been shown to inhibit the activity of cholinergic receptors, which are involved in regulation of heart rate and contractions. This compound also binds to fatty acids and hydrogen bonds with functional groups on biomolecules.
Formula:C8H7BrO3Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:231.04 g/mol



