CAS 4068-78-4
:Methyl 5-chloro-2-hydroxybenzoate
Description:
Methyl 5-chloro-2-hydroxybenzoate, with the CAS number 4068-78-4, is an organic compound that belongs to the class of benzoates. It features a methyl ester functional group, a chloro substituent, and a hydroxyl group on the benzene ring, which contributes to its reactivity and solubility properties. This compound is typically a white to off-white crystalline solid, and it is soluble in organic solvents such as ethanol and acetone, but less soluble in water due to its hydrophobic aromatic structure. Methyl 5-chloro-2-hydroxybenzoate is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, or other fine chemicals. Its chemical structure allows for various reactions, including esterification and nucleophilic substitution, making it a versatile building block in synthetic organic chemistry. Additionally, the presence of the chloro and hydroxy groups can influence its biological activity and potential applications in medicinal chemistry.
Formula:C8H7ClO3
InChI:InChI=1S/C8H7ClO3/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4,10H,1H3
InChI key:InChIKey=KJWHRMZKJXOWFC-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(O)C=CC(Cl)=C1
Synonyms:- 2-Hydroxy-5-chlorobenzoic acid methyl ester
- 5-Chloro-2-hydeoxybenzoic acid methyl ester
- 5-Chloro-2-hydroxybenzoic acid methyl ester
- 5-Chlorosalicylic acid methyl ester
- Benzoic acid, 5-chloro-2-hydroxy-, methyl ester
- Methyl 2-hydroxy-5-chlorobenzoate
- NSC 85495
- Salicylic acid, 5-chloro-, methyl ester
- methyl 5-Chlorosalicylate
- Methyl 5-chloro-2-hydroxyebenzoate
- Methyl 5-chloro-2-hydroxybenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 5-Chloro-2-Hydroxybenzoate
CAS:Formula:C8H7ClO3Purity:98%Color and Shape:SolidMolecular weight:186.5924Methyl 5-chloro-2-hydroxybenzoate
CAS:Methyl 5-chloro-2-hydroxybenzoateFormula:C8H7ClO3Purity:98%Color and Shape: pale yellow solidMolecular weight:186.59g/molMethyl 5-chlorosalicylate
CAS:Methyl 5-chlorosalicylate is a chemical compound with the molecular formula CHClO. It is a colorless liquid that has a minty odor. Methyl 5-chlorosalicylate is used in organic chemistry as an intermediate to synthesize other compounds, and it can be used in the synthesis of β-cell receptor antagonists. This drug is an analog of salicylic acid and its anti-inflammatory effects are due to the inhibition of chloride channels on macrophages. The drug's neutralizing properties have been shown by experiments with neutralizing antibody levels at physiological levels, which blocks viral replication and prevents cell damage by free radicals.Formula:C8H7ClO3Purity:Min. 95%Color and Shape:White PowderMolecular weight:186.59 g/molMethyl 5-Chloro-2-hydroxybenzoate
CAS:Formula:C8H7ClO3Purity:98%Color and Shape:SolidMolecular weight:186.59



