CAS 40682-54-0

ethyl (E)-N-benzylideneglycinate

Description:

Ethyl (E)-N-benzylideneglycinate, with the CAS number 40682-54-0, is an organic compound characterized by its structure, which includes an ethyl ester group and a benzylidene moiety. This compound typically appears as a pale yellow to light brown liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the benzylidene group contributes to its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic additions and condensation reactions. Ethyl (E)-N-benzylideneglycinate may exhibit moderate solubility in organic solvents, while its solubility in water is generally low due to its hydrophobic characteristics. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound is of interest in the field of synthetic organic chemistry for its versatile reactivity and potential applications.

Formula: C₁₁H₁₃NO₂

InChI: InChI=1/C11H13NO2/c1-2-14-11(13)9-12-8-10-6-4-3-5-7-10/h3-8H,2,9H2,1H3/b12-8+

Synonyms:

• glycine, N-(phenylmethylene)-, ethyl ester, (E)-
• Ethyl (E)-N-benzylideneglycinate
• ([1-PHENYL-METH-(E)-YLIDENE]-AMINO)-ACETIC ACID ETHYL ESTER

([1-PHENYL-METH-(E)-YLIDENE]-AMINO)-ACETIC ACID ETHYL ESTER

CAS: 40682-54-0

Formula: C₁₁H₁₃NO₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 191.2264

Ref: IN-DA00CLQM

Ethyl 2-(benzylideneamino)acetate

CAS: 40682-54-0

Ethyl 2-(benzylideneamino)acetate

Purity: 95%

Molecular weight: 191.23g/mol

Ref: 54-OR1072250

N-Benzylideneglycine ethyl ester

CAS: 40682-54-0

Molecular weight: 191.23

Ref: 7W-GM0337

N-(Phenylmethylene)glycine Ethyl Ester

CAS: 40682-54-0

Formula: C₁₁H₁₃NO₂

Molecular weight: 191.23

Ref: 4Z-G-4028

N-Benzylideneglycine ethyl ester

CAS: 40682-54-0

N-Benzylideneglycine ethyl ester is a cyclic, solid form of an alkylating agent that has a hydrocarbon group and an alkoxycarbonyl group. It is used in pharmaceutical formulations as a chiral reagent for the synthesis of amines and other compounds. N-Benzylideneglycine ethyl ester reacts with amines to produce methyl sulfones, which are then reacted with aldehydes to produce chiral cyclic ethers. This reaction can be used to synthesize adrenergic receptors, aromatic hydrocarbons, and alkoxycarbonyls.

Formula: C₁₁H₁₃NO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 191.23 g/mol

Ref: 3D-FB18390