CymitQuimica logo

CAS 40691-57-4

:

sodium 7-(methylsulfinyl)-9-oxo-9H-xanthene-2-carboxylate

Description:
Sodium 7-(methylsulfinyl)-9-oxo-9H-xanthene-2-carboxylate, identified by its CAS number 40691-57-4, is a chemical compound that belongs to the class of xanthene derivatives. This substance typically exhibits a bright color, often associated with its xanthene structure, which is known for its fluorescent properties. The presence of the methylsulfinyl group contributes to its unique reactivity and solubility characteristics, making it useful in various applications, including as a fluorescent dye or in photochemical processes. As a sodium salt, it is generally soluble in water, which enhances its utility in biological and chemical systems. The compound may also exhibit specific optical properties, making it valuable in analytical chemistry and materials science. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, sodium 7-(methylsulfinyl)-9-oxo-9H-xanthene-2-carboxylate is notable for its structural features and potential applications in various scientific fields.
Formula:C15H9NaO5S
InChI:InChI=1/C15H10O5S.Na/c1-21(19)9-3-5-13-11(7-9)14(16)10-6-8(15(17)18)2-4-12(10)20-13;/h2-7H,1H3,(H,17,18);/q;+1/p-1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Tixanox sodium

    CAS:
    Tixanox sodium effectively blocks histamine release in the lungs triggered by anti-IgE. It has also been demonstrated that when administered orally, Tixanox sodium can successfully counteract exercise-induced asthma.
    Formula:C15H9NaO5S
    Color and Shape:Solid
    Molecular weight:324.28