CAS 406933-21-9
:3-(trifluoromethyl)pyridine-2-carbonitrile
Description:
3-(Trifluoromethyl)pyridine-2-carbonitrile is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a trifluoromethyl group (-CF3) at the 3-position of the pyridine ring significantly influences its chemical properties, enhancing its lipophilicity and potentially its reactivity. The carbonitrile group (-C≡N) at the 2-position contributes to the compound's polarity and can participate in various chemical reactions, such as nucleophilic additions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique electronic properties, derived from the trifluoromethyl group, can also affect its interaction with biological targets. As with many fluorinated compounds, it may exhibit increased stability and resistance to degradation. Safety data should be consulted for handling, as the trifluoromethyl group can impart toxicity or environmental concerns. Overall, 3-(trifluoromethyl)pyridine-2-carbonitrile is a versatile compound with applications in various fields of chemistry.
Formula:C7H3F3N2
InChI:InChI=1/C7H3F3N2/c8-7(9,10)5-2-1-3-12-6(5)4-11/h1-3H
SMILES:c1cc(c(C#N)nc1)C(F)(F)F
Synonyms:- 2-Pyridinecarbonitrile, 3-(Trifluoromethyl)-
- 3-(Trifluoromethyl)-2-Pyridinecarbonitrile
- 3-Trifluoromethyl-pyridine-2-carbonitrile
- 3-(Trifluoromethyl)pyridine-2-carbonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Cyano-3-Trifluoromethylpyridine
CAS:Formula:C7H3F3N2Purity:97%Color and Shape:SolidMolecular weight:172.10733-(Trifluoromethyl)pyridine-2-carbonitrile
CAS:3-(Trifluoromethyl)pyridine-2-carbonitrileFormula:C7H3F3N2Purity:98%Color and Shape:Colourless - Yellow LiquidMolecular weight:172.11g/mol2-Cyano-3-trifluoromethylpyridine
CAS:<p>2-Cyano-3-trifluoromethylpyridine is a fine chemical that is used as a versatile building block in the synthesis of complex compounds. It can be used as an intermediate in research chemicals, reaction components, and speciality chemicals. 2-Cyano-3-trifluoromethylpyridine is a high quality reagent that can be used for the synthesis of various derivatives. It is also a useful scaffold for the development of new drugs and other chemical compounds.</p>Formula:C7H3F3N2Purity:Min. 95%Color and Shape:liquid.Molecular weight:172.11 g/mol3-(Trifluoromethyl)picolinonitrile
CAS:Formula:C7H3F3N2Purity:97%Color and Shape:LiquidMolecular weight:172.11





