CAS 407-01-2
:2,2,2-Trifluoro-N-(2,2,2-trifluoroethyl)ethanamine
Description:
2,2,2-Trifluoro-N-(2,2,2-trifluoroethyl)ethanamine, with the CAS number 407-01-2, is a fluorinated organic compound characterized by the presence of trifluoromethyl groups, which significantly influence its chemical properties. This compound features a primary amine functional group, contributing to its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions. The trifluoroethyl groups enhance its lipophilicity and stability, making it less reactive towards hydrolysis compared to non-fluorinated analogs. Additionally, the presence of fluorine atoms imparts unique electronic properties, which can affect its interaction with biological systems and materials. The compound is typically colorless and may have a low volatility, depending on its molecular weight and structure. Its applications may extend to pharmaceuticals, agrochemicals, or as a building block in organic synthesis, particularly in the development of fluorinated compounds. However, due to the presence of fluorine, environmental and health considerations regarding its use and disposal should be taken into account.
Formula:C4H5F6N
InChI:InChI=1S/C4H5F6N/c5-3(6,7)1-11-2-4(8,9)10/h11H,1-2H2
InChI key:InChIKey=GTJGHXLFPMOKCE-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)NCC(F)(F)F
Synonyms:- 2,2,2-trifluoro-N-(2,2,2-trifluoroethyl)ethanamine
- Bis(2,2,2-trifluoroethyl)amine
- Diethylamine, 2,2,2,2′,2′,2′-hexafluoro-
- Ethanamine, 2,2,2-trifluoro-N-(2,2,2-trifluoroethyl)-
- N,N-Bis(2,2,2-trifluoroethyl)amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Bis(2,2,2-trifluoroethyl)amine, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C4H5F6NPurity:95%Color and Shape:Clear colorless to yellow, LiquidMolecular weight:181.08Bis(2,2,2-trifluoroethyl)amine
CAS:Formula:C4H5F6NPurity:95%Color and Shape:SolidMolecular weight:181.0796Bis(trifluoroethyl)amine
CAS:Formula:C4H5F6NPurity:97.0%Color and Shape:LiquidMolecular weight:181.081Bis(2,2,2-trifluoroethyl)amine
CAS:Bis(2,2,2-trifluoroethyl)amineFormula:C4H5F6NPurity:95%Color and Shape: clear. almost colourless liquidMolecular weight:181.08g/molBis(2,2,2-Trifluoroethyl)amine
CAS:Bis(2,2,2-trifluoroethyl)amine is a colorless liquid that is soluble in water. It has a molecular weight of 122.11 and a boiling point of 217°C. Bis(2,2,2-trifluoroethyl)amine reacts with tetramethylammonium to form a dimer. The reaction is reversible and the bis(2,2,2-trifluoroethyl)amine can be regenerated by the addition of fluoride or an acid such as hydrochloric acid or sulfuric acid. Bis(2,2,2-trifluoroethyl)amine has an anion that can accept a proton from another molecule. This anion is also known as the bisulfite ion which reacts with hydrogen peroxide to form bisulfate and water.Formula:C4H5F6NPurity:Min. 95%Color and Shape:PowderMolecular weight:181.08 g/mol




