CAS 407-33-0
:Acetic acid, 2-fluoro-, 1,1′-anhydride
Description:
Acetic acid, 2-fluoro-, 1,1′-anhydride, with the CAS number 407-33-0, is a chemical compound characterized by its anhydride structure derived from acetic acid. This compound features a fluorine atom substituted at the second carbon position of the acetic acid moiety, which can influence its reactivity and properties. Typically, anhydrides are known for their ability to react with alcohols and amines to form esters and amides, respectively. The presence of the fluorine atom may enhance the electrophilicity of the carbonyl carbon, making it more reactive in nucleophilic acyl substitution reactions. Acetic acid anhydrides are often used in organic synthesis, particularly in the production of various chemical intermediates and pharmaceuticals. Additionally, the compound may exhibit specific physical properties such as a distinct odor and varying solubility in organic solvents. Safety precautions are essential when handling this substance, as it may be corrosive and irritant to skin and mucous membranes. Proper storage and handling protocols should be followed to mitigate any potential hazards.
Formula:C4H4F2O3
InChI:InChI=1S/C4H4F2O3/c5-1-3(7)9-4(8)2-6/h1-2H2
InChI key:InChIKey=KLLYGDXCCNXESW-UHFFFAOYSA-N
SMILES:O(C(CF)=O)C(CF)=O
Synonyms:- 2-Fluoroacetyl 2-fluoroacetate
- Acetic acid, 2-fluoro-, 1,1'-anhydride
- Acetic acid, fluoro-, anhydride
- Fluoroacetic anhydride
- Fluoroacetic anhydride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Fluoroacetic anhydride
CAS:<p>Fluoroacetic anhydride is a sulfa drug that is used in the preparation of fluoroacetic acid. Fluoroacetic acid has been used to prepare fluorescent derivatives, which are useful for the detection of bile acids and serum proteins. Fluoroacetic acid is also an electrolyte that has been used to measure the concentration of copper ions. This compound is a glycosidic bond, which forms between a hydroxyl group and a carbohydrate or other organic molecule with an oxygen atom at its end. The heterocycle in this compound is bicyclic, meaning it contains two rings linked together by one carbon atom. The fatty acid in this compound consists of a carboxylic acid attached to a hydrocarbon chain with two or more double bonds, which are often unsaturated. Fluoroacetic anhydride may be found in infectious diseases such as tuberculosis and malaria. It may also be found in autoimmune diseases such as lupus erythematos</p>Formula:C4H4F2O3Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:138.07 g/mol
