CAS 407-38-5: Acetic acid, 2,2,2-trifluoro-, 2,2,2-trifluoroethyl ester
Description:Acetic acid, 2,2,2-trifluoro-, 2,2,2-trifluoroethyl ester, commonly referred to as trifluoroethyl acetate, is an organic compound characterized by its ester functional group derived from acetic acid and trifluoroethanol. It features a trifluoromethyl group, which significantly influences its chemical properties, including increased electronegativity and volatility. This compound is typically a colorless liquid with a distinctive odor and is known for its low solubility in water but good solubility in organic solvents. Its trifluoromethyl groups contribute to its stability and resistance to hydrolysis, making it useful in various applications, including as a solvent and in organic synthesis. Additionally, trifluoroethyl acetate is utilized in the production of pharmaceuticals and agrochemicals due to its reactivity and ability to participate in various chemical reactions. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may pose health risks upon exposure.
Formula:C4H2F6O2
InChI:InChI=1S/C4H2F6O2/c5-3(6,7)1-12-2(11)4(8,9)10/h1H2
InChI key:InChIKey=ZKUJOCJJXCPCFS-UHFFFAOYSA-N
SMILES:O=C(OCC(F)(F)F)C(F)(F)F
- Synonyms:
- Trifluoroethyl trifluoroacetate
- Ethanol, 2,2,2-trifluoro-, trifluoroacetate
- 2,2,2-Trifluoroethyl trifluoroacetate
- Acetic acid, trifluoro-, 2,2,2-trifluoroethyl ester
- Acetic acid, 2,2,2-trifluoro-, 2,2,2-trifluoroethyl ester

2,2,2-Trifluoroethyl Trifluoroacetate
Ref: 3B-T1697
25g | 108.00 € |

2,2,2-Trifluoroethyl trifluoroacetate
Ref: 10-F001221
5g | 33.00 € | ||
10g | 52.00 € | ||
25g | 88.00 € | ||
100g | 210.00 € | ||
500g | 533.00 € |

2,2,2-TRIFLUOROETHYL TRIFLUOROACETATE
Ref: IN-DA003F7A
Undefined size | To inquire |

2,2,2-Trifluoroethyl trifluoroacetate
Ref: 54-PC7378
100g | 359.00 € |

2,2,2-Trifluoroethyl Trifluoroacetate
Controlled ProductRef: TR-T790310
1g | 97.00 € | ||
5g | 111.00 € | ||
10g | 155.00 € |

2,2,2-Trifluoroethyl trifluoroacetate
Ref: 3D-FT83352
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
100g | Discontinued | Request information | |
250g | Discontinued | Request information |