CAS 40709-76-0

Pyrrolidine, 1-(2-phenylcyclohexyl)-, hydrochloride, cis-

Description:

Pyrrolidine, 1-(2-phenylcyclohexyl)-, hydrochloride, cis- is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated nitrogen-containing heterocycle. The compound features a phenylcyclohexyl group attached to the nitrogen atom of the pyrrolidine, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in pharmaceutical applications. The cis- configuration indicates the specific spatial arrangement of substituents around the pyrrolidine ring, which can influence the compound's pharmacological effects and interactions with biological targets. This compound may exhibit psychoactive properties and has been studied for its potential use in various therapeutic contexts. However, due to its structural complexity and the presence of a phenyl group, it may also pose challenges in terms of synthesis and stability. As with many chemical substances, safety and handling precautions are essential, particularly in research and clinical settings.

Formula: C₁₆H₂₃N·ClH

InChI: InChI=1/C16H23N.ClH/c1-2-8-14(9-3-1)15-10-4-5-11-16(15)17-12-6-7-13-17;/h1-3,8-9,15-16H,4-7,10-13H2;1H/t15-,16-;/s2

InChI key: InChIKey=PFJUKRASTDOAQF-WZOXGBGJNA-N

SMILES: [C@@H]1([C@H](CCCC1)C2=CC=CC=C2)N3CCCC3.Cl

Synonyms:

• RX 67668
• Pyrrolidine, 1-(2-phenylcyclohexyl)-, hydrochloride, cis-

RX 67668

CAS: 40709-76-0

RX 67668: Muscle relaxant, relieves fatigue; cholinesterase inhibitor (IC50: 5 μM); reverses D-tubocurarine effects.

Formula: C₁₆H₂₄ClN

Purity: 98%

Color and Shape: Solid

Molecular weight: 265.82

Ref: TM-T16814