CAS 40716-66-3: trans-Nerolidol
Description:Trans-Nerolidol is a naturally occurring sesquiterpene alcohol characterized by its floral and woody aroma, commonly found in essential oils of various plants, including ginger and jasmine. It has a molecular formula of C15H26O and features a unique structure that includes a long carbon chain with multiple stereocenters, contributing to its isomeric forms. Trans-Nerolidol is known for its potential applications in the fragrance industry, as well as in cosmetics and personal care products due to its pleasant scent and skin-soothing properties. Additionally, it exhibits antimicrobial and anti-inflammatory activities, making it of interest in the field of natural product research and potential therapeutic applications. The substance is typically colorless to pale yellow and is soluble in organic solvents, while being less soluble in water. Its stability under various conditions makes it a valuable compound in formulations, and ongoing studies continue to explore its benefits and uses in various industries.
Formula:C15H26O
InChI:InChI=1/C15H26O/c1-6-15(5,16)12-8-11-14(4)10-7-9-13(2)3/h6,9,11,16H,1,7-8,10,12H2,2-5H3/b14-11+
InChI key:InChIKey=FQTLCLSUCSAZDY-SDNWHVSQNA-N
SMILES:OC(C=C)(C)CCC=C(C)CCC=C(C)C
- Synonyms:
- (6E)-3,7,11-Trimethyl-1,6,10-dodecatrien-3-ol
- (6E)-3,7,11-Trimethyldodeca-1,6,10-trien-3-ol
- (6E)-Nerolidol
- (E)-3,7,11-Trimethyl-1,6,10-dodecatrien-3-ol
- (E)-3,7,11-Trimethyldodeca-1,6,10-trien-3-ol
- (E)-3,7,11-trimethyldodeca-1,6,10-triene-3-ol
- (E)-3,7,11-trimetildodeca-1,6,10-trien-3-ol
- (E)-Nerolidol
- 1,6,10-Dodecatrien-3-ol, 3,7,11-trimethyl-, (6E)-
- 1,6,10-Dodecatrien-3-ol, 3,7,11-trimethyl-, (E)-
- See more synonyms
- 1-Geranyl-2-methyl-3-buten-2-ol
- Nerolidol (E)
- Nerolidol B
- Nerolidol trans-form
- trans-Nerolidol
- (±)-trans-Nerolidol
