CAS 40718-08-9
:3,5-dibromo-2-hydroxybenzonitrile
Description:
3,5-Dibromo-2-hydroxybenzonitrile, with the CAS number 40718-08-9, is an organic compound that features a benzene ring substituted with two bromine atoms, a hydroxyl group (-OH), and a nitrile group (-C≡N). This compound is characterized by its aromatic structure, which contributes to its stability and reactivity. The presence of the hydroxyl group imparts polar characteristics, enhancing its solubility in polar solvents, while the nitrile group adds to its functionality, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The bromine substituents can influence the compound's reactivity and physical properties, such as melting and boiling points, as well as its electronic properties. Additionally, 3,5-dibromo-2-hydroxybenzonitrile may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its synthesis typically involves bromination and subsequent functionalization of a suitable precursor compound, highlighting its relevance in synthetic organic chemistry.
Formula:C7H3Br2NO
InChI:InChI=1/C7H3Br2NO/c8-5-1-4(3-10)7(11)6(9)2-5/h1-2,11H
SMILES:c1c(C#N)c(c(cc1Br)Br)O
Synonyms:- Benzonitrile, 3,5-dibromo-2-hydroxy-
- Hydroxy-3,5-dibromobenzonitrile
- 3,5-Dibromo-2-hydroxybenzonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,5-Dibromo-2-hydroxybenzonitrile
CAS:Formula:C7H3Br2NOPurity:98%Color and Shape:SolidMolecular weight:276.91283,5-dibromo-2-hydroxybenzonitrile
CAS:3,5-dibromo-2-hydroxybenzonitrilePurity:≥95%Molecular weight:276.91g/mol3,5-Dibromo-2-hydroxybenzonitrile
CAS:Formula:C7H3Br2NOPurity:90%Color and Shape:SolidMolecular weight:276.9153,5-Dibromo-2-hydroxybenzonitrile
CAS:3,5-Dibromo-2-hydroxybenzonitrile is an organic compound with the formula C6H4Br2O. It is a yellow liquid that is soluble in organic solvents. 3,5-Dibromo-2-hydroxybenzonitrile can be synthesized by reacting tert-butyl nitrite with bromine and acetonitrile in a solvent. The reaction rate of this chemical reaction is rapid and the molecule has been shown to be stable when exposed to light. The hydroxyl group on the molecule makes it hydrophobic, which means it does not dissolve well in water. 3,5-Dibromo-2-hydroxybenzonitrile has a photolabile profile, meaning that it quickly decomposes when exposed to light. This chemical compound has two isomers: synopses A and B. Synopsis A has an electron configuration of 1s22s22p
Formula:C7H3Br2NOPurity:Min. 95%Molecular weight:276.92 g/mol



