CAS 40720-05-6
:1H-Thieno[3,4-d]imidazole-4-pentanoic acid, hexahydro-2-oxo-, 5,5-dioxide, (3aS,4S,6aR)-
Description:
1H-Thieno[3,4-d]imidazole-4-pentanoic acid, hexahydro-2-oxo-, 5,5-dioxide, (3aS,4S,6aR)- is a complex organic compound characterized by its unique bicyclic structure that incorporates both thieno and imidazole rings. This compound features a pentanoic acid moiety, contributing to its acidic properties, and is known for its hexahydro-2-oxo functionality, indicating the presence of a saturated cyclic structure with a ketone group. The 5,5-dioxide designation suggests the presence of two oxo groups attached to the imidazole ring, enhancing its reactivity and potential biological activity. The stereochemistry indicated by (3aS,4S,6aR) specifies the spatial arrangement of atoms in the molecule, which can significantly influence its pharmacological properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its CAS number, 40720-05-6, allows for easy identification and reference in chemical databases. Overall, this substance represents a fascinating intersection of structural complexity and potential therapeutic application.
Formula:C10H16N2O5S
InChI:InChI=1S/C10H16N2O5S/c13-8(14)4-2-1-3-7-9-6(5-18(7,16)17)11-10(15)12-9/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15)/t6-,7-,9-/m0/s1
InChI key:InChIKey=QPFQYMONYBAUCY-ZKWXMUAHSA-N
SMILES:C(CCCC(O)=O)[C@H]1[C@@]2([C@](CS1(=O)=O)(NC(=O)N2)[H])[H]
Synonyms:- 1H-Thieno[3,4-d]imidazole-4-pentanoic acid, hexahydro-2-oxo-, 5,5-dioxide, (3aS,4S,6aR)-
- Biotin sulfone
- Biotin, 5,5-dioxide
- 1H-Thieno[3,4-d]imidazole-4-pentanoic acid, hexahydro-2-oxo-, 5,5-dioxide, [3aS-(3aα,4β,6aα)]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Biotin Sulfone
CAS:Formula:C10H16N2O5SColor and Shape:White To Off-White SolidMolecular weight:276.31Biotin sulfone
CAS:Biotin sulfone is an oxidized form of biotin.Formula:C10H16N2O5SPurity:95.51% - 99.17%Color and Shape:SolidMolecular weight:276.31Biotin Sulfone
CAS:Controlled Product<p>Applications Biotin Sulfone, is derivative of Biotin (B389040), which is a growth factor present in minute amounts in every living cell, and plays an indispensable role in numerous naturally occurring carboxylation reactions.<br>References du Vigneaud, et al.: J. Biol. Chem., 146, 475 (1942), Traub, et al.: Nature, 178, 649 (1956), Siegel, H., et al.: Experienta, 37, 789 (1981), Vesely, D.L., Science, 216, 1329 (1982), Hugues, M., et al.: Biochemistry, 31, 12 (1992),<br></p>Formula:C10H16N2O5SColor and Shape:NeatMolecular weight:276.315-[(3αR,6S,6αS)-2,5,5-trioxo-1,3,3α,4,6,6α-hexahydrothieno[3,4-d]imidazol-6-yl]pentanoic acid
CAS:The compound 5-[(3aR,6S,6aS)-2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-6-yl]pentanoic acid (TIPA) is a diagnostic marker for the diagnosis of urinary tract infections. The compound is present in urine and can be detected with an antibody response. TIPA is excreted by human kidneys in a circadian pattern and has a maximum concentration at pH 7.0. This compound is taken up by bacteria in the urinary tract and its presence can be used to diagnose UTI. TIPA also binds to biotin and polyclonal antibodies that are used for immunohistochemical assays.Formula:C10H16N2O5SPurity:Min. 95%Color and Shape:White To Off-White SolidMolecular weight:276.31 g/mol





