CAS 40725-89-1
:7-(3-deoxy-beta-D-erythro-pentofuranosyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine
Description:
7-(3-deoxy-beta-D-erythro-pentofuranosyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine, with CAS number 40725-89-1, is a chemical compound that belongs to the class of nucleoside analogs. This substance features a pyrrolo[2,3-d]pyrimidine core structure, which is characterized by a fused bicyclic system that includes both pyrrole and pyrimidine rings. The presence of a 3-deoxy-beta-D-erythro-pentofuranosyl moiety indicates that it has a sugar component, which is essential for its biological activity, particularly in the context of nucleic acid metabolism. This compound may exhibit properties relevant to antiviral or anticancer activities, as many nucleoside analogs do. Its structural characteristics suggest potential interactions with nucleic acid synthesis pathways, making it a subject of interest in medicinal chemistry and drug development. The compound's solubility, stability, and reactivity would depend on its specific functional groups and the overall molecular conformation, which are critical for its biological efficacy.
Formula:C11H14N4O3
InChI:InChI=1/C11H14N4O3/c12-9-7-1-2-15(10(7)14-5-13-9)11-8(17)3-6(4-16)18-11/h1-2,5-6,8,11,16-17H,3-4H2,(H2,12,13,14)/t6-,8+,11+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3'-Deoxytubercidin
CAS:Nucleoside Derivatives - 7-Deaza-purine nucleosides; 3’-Deoxy nucleosidesFormula:C11H14N4O3Color and Shape:SolidMolecular weight:250.25Ref: TM-TNU0417
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire7-Deaza-3'-deoxyadenosine
CAS:7-Deaza-3'-deoxyadenosine is a synthetic nucleoside that is used in the synthesis of DNA. It has antiviral activity and is effective against HIV, herpes simplex virus and hepatitis B. 7-Deaza-3'-deoxyadenosine also has anticancer activity and can be used as a chemotherapeutic agent for leukemia, lymphoma, and breast cancer. This drug has been shown to inhibit the growth of cultured human tumor cells by inhibiting DNA synthesis through inhibition of DNA polymerase alpha and beta.Formula:C11H14N4O3Purity:Min. 95%Molecular weight:250.25 g/mol

