CAS 40739-73-9
:2-nitro-1-benzofuran-7-ol
Description:
2-Nitro-1-benzofuran-7-ol is an organic compound characterized by its unique structure, which includes a benzofuran ring system substituted with a nitro group and a hydroxyl group. This compound typically appears as a solid and is known for its potential applications in organic synthesis and medicinal chemistry. The presence of the nitro group contributes to its reactivity, making it a useful intermediate in various chemical reactions. The hydroxyl group enhances its solubility in polar solvents and can participate in hydrogen bonding, influencing its physical and chemical properties. Additionally, the compound may exhibit biological activity, which is of interest in pharmacological research. Its molecular structure allows for various functionalization possibilities, making it a versatile building block in the synthesis of more complex molecules. Safety and handling precautions should be observed due to the presence of the nitro group, which can pose hazards. Overall, 2-nitro-1-benzofuran-7-ol is a compound of interest in both synthetic and applied chemistry contexts.
Formula:C8H5NO4
InChI:InChI=1/C8H5NO4/c10-6-3-1-2-5-4-7(9(11)12)13-8(5)6/h1-4,10H
Synonyms:- 2-Nitro-1-benzofuran-7-ol
- 7-benzofuranol, 2-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

