CAS 40740-57-6

5-Fluorobenzo[b]thiophene-3-carboxylic acid

Description:

5-Fluorobenzo[b]thiophene-3-carboxylic acid is an organic compound characterized by its unique structure, which includes a fluorine atom attached to a benzo[b]thiophene ring system and a carboxylic acid functional group. This compound typically exhibits a solid state at room temperature and is known for its potential applications in medicinal chemistry and material science due to the presence of the thiophene moiety, which can enhance electronic properties. The fluorine substituent can influence the compound's reactivity and biological activity, often enhancing lipophilicity and metabolic stability. The carboxylic acid group contributes to its acidity and can participate in various chemical reactions, including esterification and amidation. Additionally, this compound may exhibit interesting photophysical properties, making it a candidate for use in organic electronics or as a building block in the synthesis of more complex molecules. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.

Formula: C₉H₅FO₂S

InChI: InChI=1S/C9H5FO2S/c10-5-1-2-8-6(3-5)7(4-13-8)9(11)12/h1-4H,(H,11,12)

InChI key: InChIKey=ZXOZGDMHUJRJRR-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(SC1)=CC=C(F)C2

Synonyms:

• 5-Fluorobenzothiophene-3-carboxylic acid
• Benzo[b]thiophene-3-carboxylic acid, 5-fluoro-
• 5-Fluorobenzo[b]thiophene-3-carboxylic acid

5-Fluoro-1-benzothiophene-3-carboxylic acid

CAS: 40740-57-6

5-Fluoro-1-benzothiophene-3-carboxylic acid

Molecular weight: 196.1982g/mol

Ref: 54-PC107736

5-Fluoro-benzo[b]thiophene-3-carboxylic acid

CAS: 40740-57-6

Formula: C₉H₅FO₂S

Purity: 95.0%

Molecular weight: 196.2

Ref: 10-F317680

5-Fluoro-benzo[b]thiophene-3-carboxylic acid

CAS: 40740-57-6

Versatile small molecule scaffold

Formula: C₉H₅FO₂S

Purity: Min. 95%

Molecular weight: 196.2 g/mol

Ref: 3D-QBA74057