CAS 40750-71-8
:4-(Chlorodifluoromethoxy)nitrobenzene
Description:
4-(Chlorodifluoromethoxy)nitrobenzene, with the CAS number 40750-71-8, is an organic compound characterized by the presence of a nitro group and a chlorodifluoromethoxy substituent on a benzene ring. This compound features a nitro group (-NO2) attached to the para position of the benzene, which is known for its electron-withdrawing properties, influencing the compound's reactivity and polarity. The chlorodifluoromethoxy group (-O-CHF2Cl) introduces both chlorine and fluorine atoms, contributing to the compound's unique physical and chemical properties, such as increased lipophilicity and potential applications in agrochemicals or pharmaceuticals. The presence of halogens can also enhance the compound's stability and alter its interaction with biological systems. Additionally, the compound may exhibit specific solubility characteristics in various solvents, and its reactivity can be influenced by the electron-withdrawing nature of the nitro group and the halogenated methoxy substituent. Safety and handling considerations are essential due to the potential toxicity associated with halogenated compounds.
Formula:C7H4ClF2NO3
InChI:InChI=1/C7H4ClF2NO3/c8-7(9,10)14-6-3-1-5(2-4-6)11(12)13/h1-4H
SMILES:c1cc(ccc1N(=O)=O)OC(Cl)(F)F
Synonyms:- 1-[Chloro(Difluoro)Methoxy]-4-Nitrobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
chloro(difluoro)methyl 4-nitrophenyl ether
CAS:Formula:C7H4ClF2NO3Purity:95%Color and Shape:LiquidMolecular weight:223.56144-(Chlorodifluoromethoxy)nitrobenzene
CAS:4-(Chlorodifluoromethoxy)nitrobenzeneFormula:C7H4ClF2NO3Purity:97%Color and Shape: clear. light yellow liquidMolecular weight:223.56g/mol1-(Chloro-Difluoro-Methoxy)-4-Nitro-Benzene
CAS:1-(Chloro-Difluoro-Methoxy)-4-Nitro-Benzene (1,4-DCFM) is a nitrobenzene derivative that has been shown to inhibit tumor growth by hydrogenation reduction and fluorination. It is also an effective hydrogenation catalyst for the production of polyols and can be used in the production of nylon 6. 1,4-DCFM is synthesized by nitration followed by chlorofluorination with hydrochloric acid and hydrogen fluoride. This compound has been shown to have good stability against heat and oxidation, which makes it suitable for use in organic synthesis.Formula:C7H4ClF2NO3Purity:Min. 95%Molecular weight:223.56 g/mol



