CAS 40765-34-2
:10-(1-azabicyclo[2.2.2]oct-3-ylmethyl)-10H-phenothiazine 5-oxide
Description:
10-(1-Azabicyclo[2.2.2]oct-3-ylmethyl)-10H-phenothiazine 5-oxide, with the CAS number 40765-34-2, is a chemical compound that belongs to the class of phenothiazines, which are known for their diverse pharmacological properties, including antipsychotic and antihistaminic effects. This compound features a phenothiazine core, which is characterized by a sulfur atom and a nitrogen atom within a three-ring structure, contributing to its biological activity. The presence of the azabicyclo[2.2.2]octane moiety enhances its potential for interaction with biological targets, possibly influencing its pharmacokinetics and pharmacodynamics. The 5-oxide functional group indicates the presence of an oxygen atom bonded to the sulfur atom, which may affect the compound's reactivity and stability. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C20H22N2OS
InChI:InChI=1/C20H22N2OS/c23-24-19-7-3-1-5-17(19)22(18-6-2-4-8-20(18)24)14-16-13-21-11-9-15(16)10-12-21/h1-8,15-16H,9-14H2
SMILES:c1ccc2c(c1)N(CC1CN3CCC1CC3)c1ccccc1S2=O
Synonyms:- 10H-Phenothiazine, 10-(1-azabicyclo(2.2.2)oct-3-ylmethyl)-, 5-oxide (9CI)
- LM-209SO
- mequitazine sulfoxide
- 10-(3-Quinuclidinylmethyl)-10H-phenothiazine 5-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Mequitazine Sulfoxide
CAS:Controlled ProductFormula:C20H22N2OSColor and Shape:NeatMolecular weight:338.47Mequitazine sulfoxide
CAS:Mequitazine sulfoxide is a potent histamine H1 antagonist or antihistamine.Formula:C20H22N2OSColor and Shape:SolidMolecular weight:338.47

