CAS 4078-54-0

2-(2-Bromoethyl)benzoimidazole

Description:

2-(2-Bromoethyl)benzoimidazole is a chemical compound characterized by its unique structure, which includes a benzoimidazole moiety and a bromoethyl substituent. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its aromatic and polar characteristics. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with benzoimidazole derivatives. Additionally, the compound may exhibit properties such as fluorescence or photostability, which can be advantageous in certain applications. Safety considerations should be taken into account, as brominated compounds can pose environmental and health risks. Overall, 2-(2-Bromoethyl)benzoimidazole is a versatile compound with significant implications in both research and industrial applications.

Formula: C₉H₉BrN₂

InChI: InChI=1/C9H9BrN2/c10-6-5-9-11-7-3-1-2-4-8(7)12-9/h1-4H,5-6H2,(H,11,12)

SMILES: c1ccc2c(c1)nc(CCBr)[nH]2

Synonyms:

• 2-(2-Bromoethyl)-1H-benzoimidazole
• 1H-Benzimidazole, 2-(2-bromoethyl)-

2-(2-Bromoethyl)-1H-benzo[d]imidazole

CAS: 4078-54-0

Formula: C₉H₉BrN₂

Molecular weight: 225.0852

Ref: IN-DA00CAS0

2-(2-Bromoethyl)benzimidazole

CAS: 4078-54-0

2-(2-Bromoethyl)benzimidazole

Purity: ≥95%

Molecular weight: 225.09g/mol

Ref: 54-OR470768