CAS 40786-08-1

7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropoxy]-4-oxo-8-propyl-4H-chromene-2-carboxylic acid

Description:

The chemical substance known as 7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropoxy]-4-oxo-8-propyl-4H-chromene-2-carboxylic acid, with the CAS number 40786-08-1, is a complex organic compound characterized by its chromene backbone, which is a fused bicyclic structure containing a benzene ring and a pyran ring. This compound features multiple functional groups, including a carboxylic acid, hydroxyl groups, and an acetyl group, contributing to its potential reactivity and solubility in various solvents. The presence of propyl and phenoxy substituents suggests that it may exhibit hydrophobic properties, while the hydroxyl groups can enhance hydrogen bonding capabilities. Such structural characteristics may impart biological activity, making it of interest in pharmaceutical research. The compound's specific applications and behavior would depend on its interactions with biological systems, as well as its stability under various conditions. Further studies would be necessary to elucidate its full chemical properties and potential uses.

Formula: C₂₇H₃₀O₉

InChI: InChI=1/C27H30O9/c1-4-6-19-22(10-8-17(15(3)28)25(19)31)34-13-16(29)14-35-23-11-9-18-21(30)12-24(27(32)33)36-26(18)20(23)7-5-2/h8-12,16,29,31H,4-7,13-14H2,1-3H3,(H,32,33)

SMILES: CCCc1c(ccc(C(=O)C)c1O)OCC(COc1ccc2c(=O)cc(C(=O)O)oc2c1CCC)O

Synonyms:

• 4H-1-Benzopyran-2-carboxylic acid, 7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropoxy]-4-oxo-8-propyl-
• 7-[3-(4-Acetyl-3-hydroxy-2-propylphenoxy)-2-hydroxypropoxy]-4-oxo-8-propyl-4H-chromene-2-carboxylic acid

FPL-55712

CAS: 40786-08-1

Formula: C₂₇H₂₉O₉Na

Molecular weight: 520.50

Ref: 7W-GL2593

FPL-55712

CAS: 40786-08-1

FPL-55712 is a CysLT1 leukotriene receptor antagonist.

Formula: C₂₇H₂₉NaO₉

Color and Shape: Solid

Molecular weight: 520.5

Ref: TM-T69278