
CAS 4079-56-5
:rel-1,4-Bis(phenylmethyl) (2R,3R)-2,3-dihydroxybutanedioate
Description:
Rel-1,4-Bis(phenylmethyl) (2R,3R)-2,3-dihydroxybutanedioate, with the CAS number 4079-56-5, is a chemical compound characterized by its specific stereochemistry and functional groups. It features a butanedioate backbone with two hydroxyl groups at the 2 and 3 positions, contributing to its potential as a chiral building block in organic synthesis. The presence of two phenylmethyl groups enhances its hydrophobic characteristics and may influence its solubility and reactivity in various solvents. This compound is likely to exhibit interesting properties such as chirality, which can affect its interactions in biological systems and its utility in asymmetric synthesis. Additionally, the dihydroxy functionality suggests potential for hydrogen bonding and reactivity in further chemical transformations. Overall, this compound may find applications in pharmaceuticals, agrochemicals, or as a precursor in the synthesis of more complex organic molecules. Its specific characteristics, including melting point, boiling point, and reactivity, would need to be determined through experimental methods for practical applications.
Formula:C18H18O6
InChI:InChI=1/C18H18O6/c19-15(17(21)23-11-13-7-3-1-4-8-13)16(20)18(22)24-12-14-9-5-2-6-10-14/h1-10,15-16,19-20H,11-12H2/t15-,16-/s2
InChI key:InChIKey=LCKIPSGLXMCAOF-MNSHXRSINA-N
SMILES:C(OC([C@@H]([C@H](C(OCC1=CC=CC=C1)=O)O)O)=O)C2=CC=CC=C2
Synonyms:- Tartaric acid, dibenzyl ester, (±)-
- Butanedioic acid, 2,3-dihydroxy-, bis(phenylmethyl) ester, (R*,R*)-
- Butanedioic acid, 2,3-dihydroxy-, 1,4-bis(phenylmethyl) ester, (2R,3R)-rel-
- rel-1,4-Bis(phenylmethyl) (2R,3R)-2,3-dihydroxybutanedioate
- Butanedioic acid, 2,3-dihydroxy-, bis(phenylmethyl) ester, (R*,R*)-(±)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
rel-1,4-Bis(phenylmethyl) (2R,3R)-2,3-dihydroxybutanedioate
CAS:Formula:C18H18O6Molecular weight:330.3319
