CAS 40796-97-2
:Bemesetron
Description:
Bemesetron is a chemical compound classified as a selective serotonin 5-HT3 receptor antagonist, primarily used in the medical field for its antiemetic properties, particularly in the prevention of nausea and vomiting associated with chemotherapy and surgery. It is characterized by its ability to block the action of serotonin at the 5-HT3 receptors in the central nervous system and gastrointestinal tract, thereby reducing the sensation of nausea. The compound has a specific molecular structure that contributes to its pharmacological activity, and it is typically administered in a clinical setting. Bemesetron is known for its relatively high potency and efficacy in managing emesis, making it a valuable option in supportive cancer care. Additionally, it has undergone various studies to assess its safety profile and potential side effects, which are generally mild and manageable. As with any medication, its use should be guided by a healthcare professional, taking into account individual patient needs and conditions.
Formula:C15H17Cl2NO2
InChI:InChI=1/C15H17Cl2NO2/c1-18-12-2-3-13(18)8-14(7-12)20-15(19)9-4-10(16)6-11(17)5-9/h4-6,12-14H,2-3,7-8H2,1H3/t12-,13+,14+
InChI key:InChIKey=MNJNPLVXBISNSX-WDNDVIMCNA-N
SMILES:O(C(=O)C1=CC(Cl)=CC(Cl)=C1)[C@H]2C[C@@]3(N(C)[C@](C2)(CC3)[H])[H]
Synonyms:- (1R,5S)-3-[(3,5-dichlorobenzoyl)oxy]-8-methyl-8-azoniabicyclo[3.2.1]octane
- (1R,5S)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl 3,5-dichlorobenzoate
- (3-Endo)-8-Methyl-8-Azabicyclo[3.2.1]Oct-3-Yl 3,5-Dichlorobenzoate
- 8-Methyl-8-Azabicyclo[3.2.1]Oct-3-Yl 3,5-Dichlorobenzoate
- Bemesetron
- Benzoic acid, 3,5-dichloro-, (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester
- Benzoic acid, 3,5-dichloro-, 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, endo-
- Mdl 72222
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Tropanyl-3,5-dichlorobenzoate
CAS:Formula:C15H17Cl2NO2Purity:97%Color and Shape:SolidMolecular weight:314.20703-Tropanyl-3,5-Dichlorobenzoate
CAS:3-Tropanyl-3,5-DichlorobenzoatePurity:99%Molecular weight:314.21g/molMDL 72222
CAS:MDL 72222 is a selective serotonin receptor antagonist, which is primarily used for research purposes. It is a synthetic compound specifically designed to block the 5-HT3 subtype of serotonin receptors. The mode of action of MDL 72222 involves competitive inhibition at the 5-HT3 receptor site, which is known for its role in neurotransmitter regulation within the central and peripheral nervous systems.
Formula:C15H17Cl2NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:314.21 g/molBemesetron
CAS:Bemesetron (MDL 72222) is a selective antagonist of 5-HT3 (IC50 = 0.33 nM) with neuroprotective effects.Formula:C15H17Cl2NO2Purity:99.77%Color and Shape:SolidMolecular weight:314.21




