CAS 40800-90-6

3-(Methoxymethylene)-2(3H)-benzofuranone

Description:

3-(Methoxymethylene)-2(3H)-benzofuranone, identified by its CAS number 40800-90-6, is an organic compound characterized by its unique structural features, which include a benzofuranone core with a methoxymethylene substituent. This compound typically exhibits a molecular structure that allows for various chemical interactions, making it of interest in organic synthesis and medicinal chemistry. It may display properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the methoxymethylene group, which can participate in further chemical transformations. The benzofuranone moiety is known for its biological activity, and derivatives of this compound may exhibit pharmacological properties, including anti-inflammatory or antimicrobial effects. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3-(Methoxymethylene)-2(3H)-benzofuranone represents a versatile structure in the realm of organic chemistry, with potential applications in various fields, including drug development and materials science.

Formula: C₁₀H₈O₃

InChI: InChI=1/C10H8O3/c1-12-6-8-7-4-2-3-5-9(7)13-10(8)11/h2-6H,1H3/b8-6-

SMILES: CO/C=C\1/c2ccccc2OC1=O

Synonyms:

• 3-(α-Methoxy)methylenebenzofuran-2(3H)-one
• (3Z)-3-(methoxymethylidene)-1-benzofuran-2(3H)-one

3-(Methoxymethylene)-2(3H)-benzofuranone

CAS: 40800-90-6

Formula: C₁₀H₈O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 176.1687

Ref: IN-DA00C9JH

3-(Methoxymethylene)-2(3H)-benzofuranone

Controlled Product

CAS: 40800-90-6

Applications 3-(Methoxymethylene)-2(3H)-benzofuranone is an intermediate in the synthesis of Azoxystrobin (A965150), an strobilurin fungicide.

Formula: C₁₀H₈O₃

Color and Shape: Off White To Beige

Molecular weight: 176.17

Ref: TR-M264230