CAS 40829-04-7: D-Tyrosinol hydrochloride

Description:D-Tyrosinol hydrochloride is a chemical compound that is a derivative of the amino acid tyrosine, characterized by the presence of a hydroxyl group on the aromatic ring. It is typically found in the form of a hydrochloride salt, which enhances its solubility in water. This compound is known for its role in various biochemical processes, particularly in the synthesis of neurotransmitters and hormones. D-Tyrosinol is often utilized in research and pharmaceutical applications due to its potential neuroprotective properties and its involvement in the biosynthesis of melanin. The hydrochloride form is generally more stable and easier to handle than the free base. In terms of physical properties, D-Tyrosinol hydrochloride is typically a white to off-white crystalline powder, and it is soluble in water and alcohol. Its molecular structure allows for various interactions with biological systems, making it a subject of interest in studies related to metabolism and neurobiology. As with many compounds, proper handling and storage conditions are essential to maintain its integrity and efficacy.

Formula:C₉H₁₄ClNO₂

InChI:InChI=1/C9H13NO2.ClH/c10-8(6-11)5-7-1-3-9(12)4-2-7;/h1-4,8,11-12H,5-6,10H2;1H/t8-;/m1./s1

Synonyms:
(R)-beta-Amino-4-hydroxybenzenepropanol hydrochloride
(2R)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-aminium

Found 4 products.

Product data	Purity	Price range	Estimated delivery
D-Tyrosinol hydrochloride REF: IN-DA003PWDCAS: 40829-04-7	95%	To inquire	Tue 15 Apr 25
D-Tyrosinol hydrochloride REF: 7W-GM0619CAS: 40829-04-7	≥ 98.0%	To inquire	Mon 14 Apr 25
D-Tyrosinol hydrochloride REF: 10-F210543CAS: 40829-04-7	95.0%	To inquire	Wed 23 Apr 25
D-Tyrosinol hydrochloride REF: 3D-FT50467CAS: 40829-04-7	Min. 95%	- - -	Discontinued product