CAS 40851-98-7

5-Chloro-1,3-dihydro-2H-imidazo[4,5-b]pyridin-2-one

Description:

5-Chloro-1,3-dihydro-2H-imidazo[4,5-b]pyridin-2-one is a heterocyclic compound characterized by its imidazopyridine structure, which incorporates both nitrogen and chlorine atoms. This compound features a fused bicyclic system, consisting of an imidazole ring and a pyridine ring, contributing to its unique chemical properties. The presence of the chlorine atom at the 5-position enhances its reactivity and may influence its biological activity. Typically, compounds of this class exhibit a range of pharmacological properties, making them of interest in medicinal chemistry. The molecular structure allows for potential interactions with biological targets, which can lead to various therapeutic applications. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of study in drug development and synthesis. Its CAS number, 40851-98-7, provides a unique identifier for regulatory and research purposes, facilitating its identification in chemical databases and literature.

Formula: C₆H₄ClN₃O

InChI: InChI=1S/C6H4ClN3O/c7-4-2-1-3-5(9-4)10-6(11)8-3/h1-2H,(H2,8,9,10,11)

InChI key: InChIKey=XJFIKRXIJXAJGH-UHFFFAOYSA-N

SMILES: O=C1NC=2C(N1)=NC(Cl)=CC2

Synonyms:

• 2H-Imidazo[4,5-b]pyridin-2-one, 5-chloro-1,3-dihydro-
• 5-Chloro-1,3-dihydro-2H-imidazo[4,5-b]pyridin-2-one
• 5-Chloro-1,3-dihydro-2H-imidazo[4,5-b]pyridin-2-one

5-chloro-1,3-dihydro-2H-imidazo[4,5-b]pyridin-2-one

CAS: 40851-98-7

Formula: C₆H₄ClN₃O

Purity: 95%

Color and Shape: Solid

Molecular weight: 169.5685

Ref: IN-DA00C69T

5-Chloro-1H-imidazo[4,5-b]pyridin-2(3H)-one

CAS: 40851-98-7

5-Chloro-1H-imidazo[4,5-b]pyridin-2(3H)-one

Purity: 98%

Molecular weight: 169.57g/mol

Ref: 54-OR73713

5-Chloro-1H-imidazo[4,5-b]pyridin-2(3H)-one

CAS: 40851-98-7

Formula: C₆H₄ClN₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 169.57

Ref: 10-F092099

5-Chloro-1H-imidazo[4,5-b]pyridin-2(3H)-one

CAS: 40851-98-7

5-Chloro-1H-imidazo[4,5-b]pyridin-2(3H)-one is a chemical compound that is used in analytical chemistry as an insecticide. It has been shown to cause genotoxic activity in weevils exposed to light. The compound has also been shown to have long term efficacy in plants and toxicity studies on animals. 5-Chloro-1H-imidazo[4,5-b]pyridin-2(3H)-one is metabolized by detoxification enzymes and excreted through the urine.

Purity: Min. 95%

Ref: 3D-FC142316