CymitQuimica logo

CAS 408523-59-1

:

Quinoline, 2,4-dichloro-6-nitro-

Description:
Quinoline, 2,4-dichloro-6-nitro- is a heterocyclic organic compound characterized by a quinoline backbone, which consists of a fused benzene and pyridine ring. The presence of two chlorine atoms at the 2 and 4 positions and a nitro group at the 6 position significantly influences its chemical properties and reactivity. This compound typically exhibits a yellow to brown color and is soluble in organic solvents. It is known for its potential applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. The nitro group can participate in electrophilic substitution reactions, while the chlorine atoms can serve as leaving groups or sites for further functionalization. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety considerations should be taken into account due to the presence of halogens and nitro groups, which can impart toxicity and environmental concerns. Proper handling and disposal protocols are essential when working with this substance.
Formula:C9H4Cl2N2O2
InChI:InChI=1S/C9H4Cl2N2O2/c10-7-4-9(11)12-8-2-1-5(13(14)15)3-6(7)8/h1-4H
InChI key:ZHHMYLFTTXCPRJ-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=C1[N+](=O)[O-])C(=CC(=N2)Cl)Cl
Found 4 products.