CymitQuimica logo

CAS 408537-42-8

:

(acetylamino)[2-(1H-indol-3-yl)ethyl]propanedioic acid

Description:
The chemical substance known as (acetylamino)[2-(1H-indol-3-yl)ethyl]propanedioic acid, with the CAS number 408537-42-8, is a compound that features a complex structure incorporating an indole moiety, which is characteristic of many biologically active compounds. This substance is likely to exhibit properties typical of amino acids and derivatives, including potential solubility in polar solvents due to the presence of carboxylic acid groups. The acetylamino group suggests that it may participate in various chemical reactions, such as acylation or amidation. The indole structure is known for its role in various biological processes and may contribute to the compound's potential pharmacological activities. Additionally, the presence of multiple functional groups indicates that this compound could engage in hydrogen bonding, influencing its reactivity and interactions with biological targets. Overall, this compound may have applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific biological activities and properties would require further investigation through experimental studies.
Formula:C15H16N2O5
InChI:InChI=1/C15H16N2O5/c1-9(18)17-15(13(19)20,14(21)22)7-6-10-8-16-12-5-3-2-4-11(10)12/h2-5,8,16H,6-7H2,1H3,(H,17,18)(H,19,20)(H,21,22)
SMILES:CC(=NC(CCc1c[nH]c2ccccc12)(C(=O)O)C(=O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.