CAS 40856-44-8: (-)-3-Amino-3-phenylpropanoic acid
Description:(-)-3-Amino-3-phenylpropanoic acid, also known as L-phenylalanine, is an α-amino acid that plays a crucial role in protein synthesis. It is characterized by the presence of an amino group (-NH2), a carboxylic acid group (-COOH), and a phenyl group attached to the central carbon atom, which contributes to its aromatic properties. This compound is optically active, exhibiting chirality, with the specific configuration denoted by the prefix "(-)" indicating its levorotatory nature. It is soluble in water and has a relatively high melting point compared to many other amino acids. As a building block of proteins, it is essential for the synthesis of neurotransmitters and is involved in various metabolic pathways. Additionally, L-phenylalanine is an important dietary amino acid, as humans cannot synthesize it and must obtain it from food sources. Its CAS number, 40856-44-8, is used for identification in chemical databases and regulatory contexts. Overall, (-)-3-Amino-3-phenylpropanoic acid is significant in both biochemistry and nutrition.
Formula:C9H11NO2
InChI:InChI=1S/C9H11NO2/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1
InChI key:InChIKey=UJOYFRCOTPUKAK-QMMMGPOBSA-N
SMILES:O=C(O)CC(N)C=1C=CC=CC1
- Synonyms:
- (-)-3-Amino-3-phenylpropanoic acid
- (-)-β-Aminobenzenepropanoic acid
- (3S)-3-Amino-3-phenylpropanoic acid
- (S)-3-Amino-3-phenylpropionic acid
- (S)-3-amino-3-phenyl propanoic acid
- (S)-β-Phenylalanine
- (βS)-β-Aminobenzenepropanoic acid
- <span class="text-smallcaps">D</span>-3-Amino-3-phenylpropionic acid
- Benzenepropanoic acid, β-amino-, (S)-
- Benzenepropanoic acid, β-amino-, (βS)-
- See more synonyms
